Unk-Leu-Glu-D-aIle-D-Lys(1)-D-Orn-D-Ile-D-Phe-D-His-D-Asp-D-Asn-(1)
| Internal ID | 3761aa2e-57ef-42fc-a98f-abcf1a20c418 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (4S)-4-[[(2S)-2-[[(4R)-2-[(1R,2R)-1-amino-2-methylbutyl]-4,5-dihydro-1,3-thiazole-4-carbonyl]amino]-4-methylpentanoyl]amino]-5-[[(2R,3S)-1-[[(3R,6R,9R,12R,15R,18R,21R)-3-(2-amino-2-oxoethyl)-18-(3-aminopropyl)-12-benzyl-15-[(2R)-butan-2-yl]-6-(carboxymethyl)-9-(1H-imidazol-5-ylmethyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclopentacos-21-yl]amino]-3-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCCCCC(C(=O)NC(C(=O)N1)CCCN)NC(=O)C(C(C)CC)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C2CSC(=N2)C(C(C)CC)N)CC(=O)N)CC(=O)O)CC3=CN=CN3)CC4=CC=CC=C4 |
| SMILES (Isomeric) | CC[C@@H](C)[C@@H]1C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)N[C@@H](C(=O)NCCCC[C@H](C(=O)N[C@@H](C(=O)N1)CCCN)NC(=O)[C@@H]([C@@H](C)CC)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]2CSC(=N2)[C@@H]([C@H](C)CC)N)CC(=O)N)CC(=O)O)CC3=CN=CN3)CC4=CC=CC=C4 |
| InChI | InChI=1S/C66H103N17O16S/c1-9-35(6)52(69)66-81-48(32-100-66)63(97)76-43(26-34(4)5)59(93)74-42(22-23-50(85)86)58(92)83-53(36(7)10-2)64(98)75-40-20-15-16-25-71-55(89)46(29-49(68)84)78-62(96)47(30-51(87)88)79-61(95)45(28-39-31-70-33-72-39)77-60(94)44(27-38-18-13-12-14-19-38)80-65(99)54(37(8)11-3)82-57(91)41(21-17-24-67)73-56(40)90/h12-14,18-19,31,33-37,40-48,52-54H,9-11,15-17,20-30,32,67,69H2,1-8H3,(H2,68,84)(H,70,72)(H,71,89)(H,73,90)(H,74,93)(H,75,98)(H,76,97)(H,77,94)(H,78,96)(H,79,95)(H,80,99)(H,82,91)(H,83,92)(H,85,86)(H,87,88)/t35-,36+,37-,40-,41-,42+,43+,44-,45-,46-,47-,48+,52-,53-,54-/m1/s1 |
| InChI Key | CLKOFPXJLQSYAH-YBVXDRQKSA-N |
| Popularity | 61 references in papers |
| Molecular Formula | C66H103N17O16S |
| Molecular Weight | 1422.70 g/mol |
| Exact Mass | 1421.74894144 g/mol |
| Topological Polar Surface Area (TPSA) | 556.00 Ų |
| XlogP | -4.10 |
| Atomic LogP (AlogP) | -1.68 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 31 |
| DSSTox_RID_80821 |
| DSSTox_GSID_45355 |
| Bacitracin A |
| DTXSID00858765 |
| NCGC00016582-01 |
| CAS-1405-87-4 |
| CHEMBL3183126 |
| 22601-59-8 |
| Tox21_110506 |
| Tox21_113180 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5473 | 54.73% |
| Caco-2 | - | 0.8675 | 86.75% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.5000 | 50.00% |
| Subcellular localzation | Mitochondria | 0.4232 | 42.32% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9413 | 94.13% |
| OATP1B3 inhibitior | + | 0.9480 | 94.80% |
| MATE1 inhibitior | - | 0.9209 | 92.09% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9711 | 97.11% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8733 | 87.33% |
| CYP3A4 substrate | + | 0.7479 | 74.79% |
| CYP2C9 substrate | - | 0.8067 | 80.67% |
| CYP2D6 substrate | - | 0.8493 | 84.93% |
| CYP3A4 inhibition | - | 0.9011 | 90.11% |
| CYP2C9 inhibition | - | 0.9071 | 90.71% |
| CYP2C19 inhibition | - | 0.9025 | 90.25% |
| CYP2D6 inhibition | - | 0.9231 | 92.31% |
| CYP1A2 inhibition | - | 0.9046 | 90.46% |
| CYP2C8 inhibition | + | 0.8296 | 82.96% |
| CYP inhibitory promiscuity | - | 0.9122 | 91.22% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6027 | 60.27% |
| Eye corrosion | - | 0.9851 | 98.51% |
| Eye irritation | - | 0.8957 | 89.57% |
| Skin irritation | - | 0.7691 | 76.91% |
| Skin corrosion | - | 0.9241 | 92.41% |
| Ames mutagenesis | - | 0.7200 | 72.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7074 | 70.74% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | + | 0.7427 | 74.27% |
| skin sensitisation | - | 0.8334 | 83.34% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9484 | 94.84% |
| Mitochondrial toxicity | + | 0.8125 | 81.25% |
| Nephrotoxicity | + | 0.7838 | 78.38% |
| Acute Oral Toxicity (c) | III | 0.5690 | 56.90% |
| Estrogen receptor binding | + | 0.5297 | 52.97% |
| Androgen receptor binding | + | 0.7213 | 72.13% |
| Thyroid receptor binding | + | 0.7200 | 72.00% |
| Glucocorticoid receptor binding | + | 0.7992 | 79.92% |
| Aromatase binding | + | 0.8026 | 80.26% |
| PPAR gamma | + | 0.7143 | 71.43% |
| Honey bee toxicity | - | 0.6599 | 65.99% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5200 | 52.00% |
| Fish aquatic toxicity | + | 0.9177 | 91.77% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.84% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.60% | 96.09% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 99.49% | 88.42% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.38% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.27% | 97.64% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.19% | 97.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.64% | 98.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.63% | 97.09% |
| CHEMBL4071 | P08311 | Cathepsin G | 96.26% | 94.64% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 96.03% | 88.10% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.93% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 95.66% | 98.05% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.64% | 90.20% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.51% | 93.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 95.42% | 96.61% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 95.42% | 97.43% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 95.36% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.50% | 96.90% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 94.09% | 90.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.52% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.90% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.06% | 93.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.94% | 100.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.33% | 98.24% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 90.69% | 96.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.49% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.36% | 95.56% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.73% | 95.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.51% | 95.89% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 89.41% | 98.94% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 89.23% | 95.50% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 89.22% | 93.85% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.12% | 85.14% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.96% | 100.00% |
| CHEMBL4801 | P29466 | Caspase-1 | 87.91% | 96.85% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.83% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.01% | 98.75% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 86.80% | 95.93% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 86.42% | 89.92% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.92% | 97.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.60% | 97.14% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.57% | 100.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.42% | 90.71% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 85.31% | 82.86% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.40% | 96.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.25% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.86% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.50% | 96.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.30% | 92.88% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 83.15% | 96.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.13% | 99.23% |
| CHEMBL1801 | P00747 | Plasminogen | 82.97% | 92.44% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 82.67% | 88.56% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.31% | 95.38% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.65% | 98.59% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.63% | 95.71% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.42% | 97.06% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 81.27% | 96.47% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.54% | 94.62% |
| CHEMBL5028 | O14672 | ADAM10 | 80.52% | 97.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 80.11% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 60196264 |
| LOTUS | LTS0228137 |
| wikiData | Q81977815 |