Unk-Leu-D-Glu-D-xiThr(1)-D-Val-Leu-D-Ser-Leu-D-Ser-Ile-(1)
| Internal ID | ad8811f3-cfa6-494a-8653-740e5c20f8e4 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4R)-5-[[(3S,6R,9S,12R,15S,18R,21R)-3-[(2S)-butan-2-yl]-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]amino]-4-[[(2S)-2-(3-hydroxydecanoylamino)-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)C(C)CC)C)O |
| SMILES (Isomeric) | CCCCCCCC(CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H]1C(OC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)[C@@H](C)CC)C)O |
| InChI | InChI=1S/C54H95N9O16/c1-13-15-16-17-18-19-34(66)25-41(67)55-36(22-28(3)4)47(71)56-35(20-21-42(68)69)46(70)63-45-33(12)79-54(78)44(32(11)14-2)62-51(75)40(27-65)60-48(72)37(23-29(5)6)57-50(74)39(26-64)59-49(73)38(24-30(7)8)58-52(76)43(31(9)10)61-53(45)77/h28-40,43-45,64-66H,13-27H2,1-12H3,(H,55,67)(H,56,71)(H,57,74)(H,58,76)(H,59,73)(H,60,72)(H,61,77)(H,62,75)(H,63,70)(H,68,69)/t32-,33?,34?,35+,36-,37-,38-,39+,40+,43+,44-,45+/m0/s1 |
| InChI Key | QYEWAEAWMXRMHB-RDGUDDKTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C54H95N9O16 |
| Molecular Weight | 1126.40 g/mol |
| Exact Mass | 1125.68967798 g/mol |
| Topological Polar Surface Area (TPSA) | 386.00 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.81% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.07% | 96.61% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.40% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.14% | 93.56% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.94% | 92.08% |
| CHEMBL4801 | P29466 | Caspase-1 | 96.73% | 96.85% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.13% | 96.47% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 94.68% | 96.90% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.63% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.60% | 91.11% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.45% | 89.63% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.20% | 98.05% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 94.09% | 90.08% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 92.02% | 96.00% |
| CHEMBL3468 | P55210 | Caspase-7 | 91.81% | 95.68% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 91.09% | 97.29% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.73% | 91.81% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.52% | 90.20% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.23% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.61% | 95.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 89.60% | 97.06% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 88.79% | 89.50% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.38% | 97.23% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.22% | 90.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.08% | 90.71% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.01% | 97.14% |
| CHEMBL1949 | P62937 | Cyclophilin A | 86.41% | 98.57% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.53% | 94.75% |
| CHEMBL4662 | P28074 | Proteasome Macropain subunit MB1 | 85.25% | 93.85% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.16% | 92.50% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.53% | 99.23% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.43% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 84.42% | 98.10% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 83.95% | 92.32% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.71% | 99.35% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.69% | 94.66% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 83.61% | 96.11% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.51% | 93.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.50% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.89% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.73% | 91.19% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.70% | 100.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 82.45% | 97.64% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 82.29% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.11% | 97.09% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.83% | 90.24% |
| CHEMBL1801 | P00747 | Plasminogen | 81.73% | 92.44% |
| CHEMBL4374 | Q9Y5X4 | Photoreceptor-specific nuclear receptor | 81.62% | 85.00% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 80.71% | 98.03% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.29% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584799 |
| LOTUS | LTS0212924 |
| wikiData | Q77376019 |