(2R)-N-[(3S,6R,9S,12R,15S,18R,21R,22S)-3-[(2S)-butan-2-yl]-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]-2-[[(2S)-2-[[(3R)-3-hydroxydecanoyl]amino]-4-methylpentanoyl]amino]pentanediamide
| Internal ID | bd4c92b8-6ad5-431e-8f6d-879f8d026a2a |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R)-N-[(3S,6R,9S,12R,15S,18R,21R,22S)-3-[(2S)-butan-2-yl]-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]-2-[[(2S)-2-[[(3R)-3-hydroxydecanoyl]amino]-4-methylpentanoyl]amino]pentanediamide |
| SMILES (Canonical) | CCCCCCCC(CC(=O)NC(CC(C)C)C(=O)NC(CCC(=O)N)C(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)C(C)CC)C)O |
| SMILES (Isomeric) | CCCCCCC[C@H](CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCC(=O)N)C(=O)N[C@@H]1[C@@H](OC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H](NC1=O)C(C)C)CC(C)C)CO)CC(C)C)CO)[C@@H](C)CC)C)O |
| InChI | InChI=1S/C54H96N10O15/c1-13-15-16-17-18-19-34(67)25-42(69)56-36(22-28(3)4)47(71)57-35(20-21-41(55)68)46(70)64-45-33(12)79-54(78)44(32(11)14-2)63-51(75)40(27-66)61-48(72)37(23-29(5)6)58-50(74)39(26-65)60-49(73)38(24-30(7)8)59-52(76)43(31(9)10)62-53(45)77/h28-40,43-45,65-67H,13-27H2,1-12H3,(H2,55,68)(H,56,69)(H,57,71)(H,58,74)(H,59,76)(H,60,73)(H,61,72)(H,62,77)(H,63,75)(H,64,70)/t32-,33-,34+,35+,36-,37-,38-,39+,40+,43+,44-,45+/m0/s1 |
| InChI Key | SBKWAHPUHRUGMG-CVPKQJCRSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C54H96N10O15 |
| Molecular Weight | 1125.40 g/mol |
| Exact Mass | 1124.70566239 g/mol |
| Topological Polar Surface Area (TPSA) | 392.00 Ų |
| XlogP | 4.50 |
| Atomic LogP (AlogP) | -0.50 |
| H-Bond Acceptor | 15 |
| H-Bond Donor | 13 |
| Rotatable Bonds | 27 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8601 | 86.01% |
| Blood Brain Barrier | - | 0.9000 | 90.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.4266 | 42.66% |
| OATP2B1 inhibitior | - | 0.8623 | 86.23% |
| OATP1B1 inhibitior | + | 0.8288 | 82.88% |
| OATP1B3 inhibitior | + | 0.9007 | 90.07% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9575 | 95.75% |
| P-glycoprotein inhibitior | + | 0.7399 | 73.99% |
| P-glycoprotein substrate | + | 0.8945 | 89.45% |
| CYP3A4 substrate | + | 0.7009 | 70.09% |
| CYP2C9 substrate | - | 0.6105 | 61.05% |
| CYP2D6 substrate | - | 0.8518 | 85.18% |
| CYP3A4 inhibition | - | 0.7093 | 70.93% |
| CYP2C9 inhibition | - | 0.9428 | 94.28% |
| CYP2C19 inhibition | - | 0.9294 | 92.94% |
| CYP2D6 inhibition | - | 0.9240 | 92.40% |
| CYP1A2 inhibition | - | 0.9358 | 93.58% |
| CYP2C8 inhibition | + | 0.6269 | 62.69% |
| CYP inhibitory promiscuity | - | 0.9909 | 99.09% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8400 | 84.00% |
| Carcinogenicity (trinary) | Non-required | 0.6137 | 61.37% |
| Eye corrosion | - | 0.9848 | 98.48% |
| Eye irritation | - | 0.8968 | 89.68% |
| Skin irritation | - | 0.7880 | 78.80% |
| Skin corrosion | - | 0.9335 | 93.35% |
| Ames mutagenesis | - | 0.7100 | 71.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6474 | 64.74% |
| Micronuclear | + | 0.7800 | 78.00% |
| Hepatotoxicity | + | 0.5147 | 51.47% |
| skin sensitisation | - | 0.8728 | 87.28% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7444 | 74.44% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.5539 | 55.39% |
| Acute Oral Toxicity (c) | III | 0.7165 | 71.65% |
| Estrogen receptor binding | + | 0.7404 | 74.04% |
| Androgen receptor binding | + | 0.6581 | 65.81% |
| Thyroid receptor binding | - | 0.5264 | 52.64% |
| Glucocorticoid receptor binding | + | 0.6476 | 64.76% |
| Aromatase binding | + | 0.6741 | 67.41% |
| PPAR gamma | + | 0.7766 | 77.66% |
| Honey bee toxicity | - | 0.7511 | 75.11% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.6542 | 65.42% |
| Fish aquatic toxicity | - | 0.5076 | 50.76% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.64% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.88% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.74% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.38% | 98.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.96% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.95% | 96.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.76% | 96.47% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.63% | 92.08% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 95.31% | 91.81% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.88% | 97.23% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.68% | 89.63% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.36% | 97.29% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.40% | 96.85% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.39% | 97.25% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.31% | 97.09% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.69% | 96.90% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.35% | 95.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.62% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.17% | 90.08% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.06% | 90.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.91% | 89.50% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.90% | 96.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 88.82% | 96.11% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 88.36% | 98.03% |
| CHEMBL1949 | P62937 | Cyclophilin A | 88.32% | 98.57% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.78% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.94% | 97.14% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.99% | 92.88% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.83% | 92.32% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.39% | 94.80% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.57% | 90.24% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.53% | 100.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 83.44% | 99.35% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.25% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.08% | 93.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.78% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 82.23% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.01% | 90.17% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.83% | 97.64% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.58% | 99.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.48% | 98.33% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 80.47% | 88.42% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.28% | 94.75% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 80.17% | 95.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 153274310 |
| LOTUS | LTS0023471 |
| wikiData | Q105249508 |