Unk-DL-xiIle-DL-Arg-ol
| Internal ID | e76779f3-e8d2-4617-902a-e4cca4cea9f1 |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | N-[5-(diaminomethylideneamino)-1-hydroxypentan-2-yl]-2-[[2-hydroxy-4-(4-hydroxyphenyl)butanoyl]amino]-3-methylpentanamide |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCCN=C(N)N)CO)NC(=O)C(CCC1=CC=C(C=C1)O)O |
| SMILES (Isomeric) | CCC(C)C(C(=O)NC(CCCN=C(N)N)CO)NC(=O)C(CCC1=CC=C(C=C1)O)O |
| InChI | InChI=1S/C22H37N5O5/c1-3-14(2)19(21(32)26-16(13-28)5-4-12-25-22(23)24)27-20(31)18(30)11-8-15-6-9-17(29)10-7-15/h6-7,9-10,14,16,18-19,28-30H,3-5,8,11-13H2,1-2H3,(H,26,32)(H,27,31)(H4,23,24,25) |
| InChI Key | NFEXMBMBZZNYQK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H37N5O5 |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.27946930 g/mol |
| Topological Polar Surface Area (TPSA) | 183.00 Ų |
| XlogP | 0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.16% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.55% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.74% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.01% | 99.17% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.32% | 100.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.87% | 94.45% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.30% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.42% | 96.95% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.71% | 90.71% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 91.37% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.18% | 93.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.07% | 98.75% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.87% | 97.29% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 88.71% | 97.88% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 87.78% | 97.23% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 86.92% | 94.00% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.29% | 96.37% |
| CHEMBL236 | P41143 | Delta opioid receptor | 85.81% | 99.35% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.68% | 95.89% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 85.65% | 87.16% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 85.14% | 97.21% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 85.07% | 94.36% |
| CHEMBL3837 | P07711 | Cathepsin L | 84.68% | 96.61% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.21% | 95.56% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.40% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.31% | 94.73% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.40% | 98.05% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 81.79% | 92.86% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.72% | 95.89% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.70% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.16% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163150632 |
| LOTUS | LTS0009756 |
| wikiData | Q105178427 |