Unk-DL-Cit-DL-Ser-DL-Dab(1)-DL-Asp(3-OH)-DL-Asn-ol.H-DL-xiThr-(1)
| Internal ID | 74bfc864-39ce-46dc-b1fa-3b5869a99874 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[[4-[(2-amino-3-hydroxybutanoyl)amino]-2-[[2-[[5-(carbamoylamino)-2-(dec-2-enoylamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]butanoyl]amino]-4-[(4-amino-1-hydroxy-4-oxobutan-2-yl)amino]-2-hydroxy-4-oxobutanoic acid |
| SMILES (Canonical) | CCCCCCCC=CC(=O)NC(CCCNC(=O)N)C(=O)NC(CO)C(=O)NC(CCNC(=O)C(C(C)O)N)C(=O)NC(C(C(=O)O)O)C(=O)NC(CC(=O)N)CO |
| SMILES (Isomeric) | CCCCCCCC=CC(=O)NC(CCCNC(=O)N)C(=O)NC(CO)C(=O)NC(CCNC(=O)C(C(C)O)N)C(=O)NC(C(C(=O)O)O)C(=O)NC(CC(=O)N)CO |
| InChI | InChI=1S/C35H62N10O14/c1-3-4-5-6-7-8-9-12-25(50)42-21(11-10-14-40-35(38)59)29(52)44-23(18-47)31(54)43-22(13-15-39-32(55)26(37)19(2)48)30(53)45-27(28(51)34(57)58)33(56)41-20(17-46)16-24(36)49/h9,12,19-23,26-28,46-48,51H,3-8,10-11,13-18,37H2,1-2H3,(H2,36,49)(H,39,55)(H,41,56)(H,42,50)(H,43,54)(H,44,52)(H,45,53)(H,57,58)(H3,38,40,59) |
| InChI Key | UKZCPYJTHXIGBQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H62N10O14 |
| Molecular Weight | 846.90 g/mol |
| Exact Mass | 846.44469669 g/mol |
| Topological Polar Surface Area (TPSA) | 417.00 Ų |
| XlogP | -6.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.41% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.86% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.61% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.18% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.44% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.66% | 96.09% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 94.85% | 91.81% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 94.19% | 97.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.86% | 98.33% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.74% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 93.32% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.39% | 92.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 91.95% | 92.86% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.51% | 95.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.48% | 96.47% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.93% | 90.20% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.36% | 95.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 90.26% | 97.06% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 90.20% | 96.90% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.18% | 98.94% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.96% | 100.00% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.51% | 92.08% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.08% | 97.21% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.01% | 99.35% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.63% | 98.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.61% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.25% | 96.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.11% | 93.00% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 86.24% | 97.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.10% | 87.45% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.66% | 96.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 85.64% | 95.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 85.26% | 89.63% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 84.76% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.64% | 95.50% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 84.59% | 86.67% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.04% | 96.95% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.34% | 100.00% |
| CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 82.32% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.24% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.87% | 91.11% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.84% | 92.32% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 81.81% | 98.03% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 81.73% | 98.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.53% | 89.34% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.28% | 94.33% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.77% | 83.82% |
| CHEMBL3308 | P55212 | Caspase-6 | 80.20% | 97.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163002216 |
| LOTUS | LTS0008323 |
| wikiData | Q104198325 |