Unk-Asn-Asp(3R-OH)-D-Lys(1)-D-Arg-D-Asp(3S-OH)-Gly-(1)
| Internal ID | 5a9b47c0-e725-466f-9535-023a98743038 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2R,3S)-3-[[(2S)-4-amino-2-[[(3S,4R)-4-amino-8-[(2,3-dihydroxy-4-sulfobenzoyl)amino]-3-hydroxyoctanoyl]amino]-4-oxobutanoyl]amino]-4-[[(6R,9R,12R)-6-[(S)-carboxy(hydroxy)methyl]-9-[3-(diaminomethylideneamino)propyl]-2,5,8,11-tetraoxo-1,4,7,10-tetrazacyclohexadec-12-yl]amino]-2-hydroxy-4-oxobutanoic acid |
| SMILES (Canonical) | C1CCNC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(C1)NC(=O)C(C(C(=O)O)O)NC(=O)C(CC(=O)N)NC(=O)CC(C(CCCCNC(=O)C2=C(C(=C(C=C2)S(=O)(=O)O)O)O)N)O)CCCN=C(N)N)C(C(=O)O)O |
| SMILES (Isomeric) | C1CCNC(=O)CNC(=O)[C@H](NC(=O)[C@H](NC(=O)[C@@H](C1)NC(=O)[C@H]([C@H](C(=O)O)O)NC(=O)[C@H](CC(=O)N)NC(=O)C[C@@H]([C@@H](CCCCNC(=O)C2=C(C(=C(C=C2)S(=O)(=O)O)O)O)N)O)CCCN=C(N)N)[C@@H](C(=O)O)O |
| InChI | InChI=1S/C41H63N13O21S/c42-18(6-1-3-12-47-33(63)17-9-10-23(76(73,74)75)30(60)29(17)59)22(55)15-25(57)50-21(14-24(43)56)36(66)54-28(32(62)40(71)72)38(68)52-19-7-2-4-11-46-26(58)16-49-37(67)27(31(61)39(69)70)53-35(65)20(51-34(19)64)8-5-13-48-41(44)45/h9-10,18-22,27-28,31-32,55,59-62H,1-8,11-16,42H2,(H2,43,56)(H,46,58)(H,47,63)(H,49,67)(H,50,57)(H,51,64)(H,52,68)(H,53,65)(H,54,66)(H,69,70)(H,71,72)(H4,44,45,48)(H,73,74,75)/t18-,19-,20-,21+,22+,27-,28+,31+,32-/m1/s1 |
| InChI Key | FMENUGFMERBZKJ-PXOZWBGXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H63N13O21S |
| Molecular Weight | 1106.10 g/mol |
| Exact Mass | 1105.39821724 g/mol |
| Topological Polar Surface Area (TPSA) | 605.00 Ų |
| XlogP | -9.00 |
| Atomic LogP (AlogP) | -9.02 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 25 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.6695 | 66.95% |
| Caco-2 | - | 0.8593 | 85.93% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Nucleus | 0.4333 | 43.33% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8328 | 83.28% |
| OATP1B3 inhibitior | + | 0.9391 | 93.91% |
| MATE1 inhibitior | - | 0.8400 | 84.00% |
| OCT2 inhibitior | - | 0.6250 | 62.50% |
| BSEP inhibitior | + | 0.6682 | 66.82% |
| P-glycoprotein inhibitior | + | 0.7407 | 74.07% |
| P-glycoprotein substrate | + | 0.8768 | 87.68% |
| CYP3A4 substrate | + | 0.7381 | 73.81% |
| CYP2C9 substrate | - | 0.8095 | 80.95% |
| CYP2D6 substrate | - | 0.8295 | 82.95% |
| CYP3A4 inhibition | - | 0.9585 | 95.85% |
| CYP2C9 inhibition | - | 0.7713 | 77.13% |
| CYP2C19 inhibition | - | 0.7641 | 76.41% |
| CYP2D6 inhibition | - | 0.8643 | 86.43% |
| CYP1A2 inhibition | - | 0.8023 | 80.23% |
| CYP2C8 inhibition | + | 0.7943 | 79.43% |
| CYP inhibitory promiscuity | - | 0.9850 | 98.50% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | + | 0.5392 | 53.92% |
| Carcinogenicity (trinary) | Non-required | 0.5971 | 59.71% |
| Eye corrosion | - | 0.9769 | 97.69% |
| Eye irritation | - | 0.8963 | 89.63% |
| Skin irritation | - | 0.7584 | 75.84% |
| Skin corrosion | - | 0.9026 | 90.26% |
| Ames mutagenesis | - | 0.5798 | 57.98% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3860 | 38.60% |
| Micronuclear | + | 0.9200 | 92.00% |
| Hepatotoxicity | - | 0.5273 | 52.73% |
| skin sensitisation | - | 0.8286 | 82.86% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | + | 0.6444 | 64.44% |
| Mitochondrial toxicity | + | 0.7375 | 73.75% |
| Nephrotoxicity | - | 0.5874 | 58.74% |
| Acute Oral Toxicity (c) | III | 0.5675 | 56.75% |
| Estrogen receptor binding | + | 0.7115 | 71.15% |
| Androgen receptor binding | + | 0.7032 | 70.32% |
| Thyroid receptor binding | + | 0.5605 | 56.05% |
| Glucocorticoid receptor binding | + | 0.5720 | 57.20% |
| Aromatase binding | + | 0.6832 | 68.32% |
| PPAR gamma | + | 0.6839 | 68.39% |
| Honey bee toxicity | - | 0.7015 | 70.15% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.7000 | 70.00% |
| Fish aquatic toxicity | + | 0.7285 | 72.85% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 100.00% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.86% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.19% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.16% | 94.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 97.81% | 92.88% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 97.15% | 88.42% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 97.00% | 97.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 96.20% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.15% | 97.09% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 95.82% | 93.10% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.99% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 94.05% | 96.38% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.16% | 98.05% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.94% | 93.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.79% | 95.93% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 92.60% | 82.86% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 91.87% | 96.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.70% | 98.75% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.68% | 93.03% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 91.49% | 95.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 91.17% | 95.50% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 90.96% | 90.20% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 90.78% | 80.71% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.70% | 93.56% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 90.65% | 98.94% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.10% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.92% | 96.90% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.21% | 100.00% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 89.17% | 99.23% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 88.90% | 98.24% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 87.33% | 93.18% |
| CHEMBL1795117 | Q8TEK3 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | 87.00% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.87% | 96.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 86.87% | 98.33% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 85.98% | 82.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 85.96% | 91.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.93% | 97.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.82% | 90.08% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.55% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.70% | 99.17% |
| CHEMBL1801 | P00747 | Plasminogen | 83.92% | 92.44% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.69% | 95.56% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 83.56% | 96.67% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 83.46% | 96.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.11% | 91.19% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 82.82% | 85.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.66% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 82.50% | 99.35% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.06% | 94.33% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 82.01% | 97.00% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 81.83% | 89.67% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 81.24% | 88.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.14% | 99.23% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 80.59% | 94.01% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Achillea tomentosa |
| PubChem | 163062878 |
| LOTUS | LTS0164082 |
| wikiData | Q105111614 |