Ulongapeptin
| Internal ID | 3ecbd68f-0120-428a-86bb-3ef04824fa87 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2S,5S,8S,11R,14R,17S,20S,21S)-14-benzyl-2,4,10,13,21-pentamethyl-20-pent-4-ynyl-5,8,11,17-tetra(propan-2-yl)-1-oxa-4,7,10,13,16,19-hexazacyclodocosane-3,6,9,12,15,18,22-heptone |
| SMILES (Canonical) | CC1C(NC(=O)C(NC(=O)C(N(C(=O)C(N(C(=O)C(NC(=O)C(N(C(=O)C(OC1=O)C)C)C(C)C)C(C)C)C)C(C)C)C)CC2=CC=CC=C2)C(C)C)CCCC#C |
| SMILES (Isomeric) | C[C@H]1[C@@H](NC(=O)[C@@H](NC(=O)[C@H](N(C(=O)[C@H](N(C(=O)[C@@H](NC(=O)[C@@H](N(C(=O)[C@@H](OC1=O)C)C)C(C)C)C(C)C)C)C(C)C)C)CC2=CC=CC=C2)C(C)C)CCCC#C |
| InChI | InChI=1S/C44H68N6O8/c1-15-16-18-23-32-29(10)44(57)58-30(11)41(54)49(13)36(27(6)7)40(53)47-35(26(4)5)42(55)50(14)37(28(8)9)43(56)48(12)33(24-31-21-19-17-20-22-31)38(51)46-34(25(2)3)39(52)45-32/h1,17,19-22,25-30,32-37H,16,18,23-24H2,2-14H3,(H,45,52)(H,46,51)(H,47,53)/t29-,30-,32-,33+,34-,35-,36-,37+/m0/s1 |
| InChI Key | KLTWAAGRSKZRSM-OLLKMYFESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C44H68N6O8 |
| Molecular Weight | 809.00 g/mol |
| Exact Mass | 808.50986315 g/mol |
| Topological Polar Surface Area (TPSA) | 175.00 Ų |
| XlogP | 6.20 |
| CHEMBL526375 |
| SCHEMBL16432050 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.69% | 98.95% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.94% | 93.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.48% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.36% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.14% | 85.14% |
| CHEMBL1949 | P62937 | Cyclophilin A | 93.69% | 98.57% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 93.09% | 91.76% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.05% | 97.79% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 90.37% | 90.08% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 87.34% | 89.67% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 86.61% | 90.17% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.15% | 93.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.11% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.06% | 94.73% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 83.83% | 97.64% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.63% | 97.25% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 81.66% | 96.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.61% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.33% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10974841 |
| LOTUS | LTS0235154 |
| wikiData | Q105142815 |