TyrLysSerAspSerPheTyrGlyLeuMet
| Internal ID | 77ca880d-a0b3-4485-8c9e-070dea73e50e |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-4-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[2-[[(2S)-1-[[(2S)-1-amino-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CCSC)C(=O)N)NC(=O)CNC(=O)C(CC1=CC=C(C=C1)O)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CO)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(CC3=CC=C(C=C3)O)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N[C@@H](CCSC)C(=O)N)NC(=O)CNC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC3=CC=C(C=C3)O)N |
| InChI | InChI=1S/C56H80N12O16S/c1-31(2)23-40(52(80)62-38(48(59)76)20-22-85-3)61-46(73)28-60-50(78)41(26-34-14-18-36(72)19-15-34)64-53(81)42(25-32-9-5-4-6-10-32)65-55(83)45(30-70)68-54(82)43(27-47(74)75)66-56(84)44(29-69)67-51(79)39(11-7-8-21-57)63-49(77)37(58)24-33-12-16-35(71)17-13-33/h4-6,9-10,12-19,31,37-45,69-72H,7-8,11,20-30,57-58H2,1-3H3,(H2,59,76)(H,60,78)(H,61,73)(H,62,80)(H,63,77)(H,64,81)(H,65,83)(H,66,84)(H,67,79)(H,68,82)(H,74,75)/t37-,38-,39-,40-,41-,42-,43-,44-,45-/m0/s1 |
| InChI Key | ONJQALZQTBFYIT-NVAZTIMOSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C56H80N12O16S |
| Molecular Weight | 1209.40 g/mol |
| Exact Mass | 1208.55359568 g/mol |
| Topological Polar Surface Area (TPSA) | 501.00 Ų |
| XlogP | -3.50 |
| Atomic LogP (AlogP) | -3.68 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 17 |
| Rotatable Bonds | 38 |
| 135690-48-1 |
| CHEMBL415159 |
| Ranatachykinin B |
| SCHEMBL30475005 |
| BDBM50087850 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8560 | 85.60% |
| Caco-2 | - | 0.8701 | 87.01% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.6376 | 63.76% |
| OATP2B1 inhibitior | - | 0.8571 | 85.71% |
| OATP1B1 inhibitior | + | 0.8773 | 87.73% |
| OATP1B3 inhibitior | + | 0.9338 | 93.38% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9613 | 96.13% |
| P-glycoprotein inhibitior | + | 0.7424 | 74.24% |
| P-glycoprotein substrate | + | 0.8840 | 88.40% |
| CYP3A4 substrate | + | 0.6934 | 69.34% |
| CYP2C9 substrate | - | 0.5967 | 59.67% |
| CYP2D6 substrate | - | 0.8173 | 81.73% |
| CYP3A4 inhibition | - | 0.8808 | 88.08% |
| CYP2C9 inhibition | - | 0.8673 | 86.73% |
| CYP2C19 inhibition | - | 0.8159 | 81.59% |
| CYP2D6 inhibition | - | 0.7243 | 72.43% |
| CYP1A2 inhibition | - | 0.9062 | 90.62% |
| CYP2C8 inhibition | + | 0.6833 | 68.33% |
| CYP inhibitory promiscuity | - | 0.9695 | 96.95% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.6701 | 67.01% |
| Eye corrosion | - | 0.9897 | 98.97% |
| Eye irritation | - | 0.8968 | 89.68% |
| Skin irritation | - | 0.8091 | 80.91% |
| Skin corrosion | - | 0.9385 | 93.85% |
| Ames mutagenesis | - | 0.8700 | 87.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7140 | 71.40% |
| Micronuclear | + | 0.7000 | 70.00% |
| Hepatotoxicity | - | 0.7114 | 71.14% |
| skin sensitisation | - | 0.8840 | 88.40% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | + | 0.4635 | 46.35% |
| Acute Oral Toxicity (c) | III | 0.7287 | 72.87% |
| Estrogen receptor binding | + | 0.6855 | 68.55% |
| Androgen receptor binding | + | 0.7743 | 77.43% |
| Thyroid receptor binding | + | 0.6384 | 63.84% |
| Glucocorticoid receptor binding | + | 0.7194 | 71.94% |
| Aromatase binding | + | 0.6846 | 68.46% |
| PPAR gamma | + | 0.6906 | 69.06% |
| Honey bee toxicity | - | 0.7801 | 78.01% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5900 | 59.00% |
| Fish aquatic toxicity | + | 0.8753 | 87.53% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.96% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 99.74% | 90.20% |
| CHEMBL236 | P41143 | Delta opioid receptor | 99.30% | 99.35% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 98.72% | 97.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.80% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.09% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 97.06% | 97.21% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.02% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.22% | 93.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 95.52% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.36% | 100.00% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 95.25% | 96.67% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.83% | 100.00% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 94.16% | 91.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.63% | 93.00% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 91.20% | 100.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.88% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.76% | 95.56% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 90.37% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 90.28% | 89.33% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 89.79% | 98.89% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 88.80% | 98.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 88.76% | 92.80% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.60% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.43% | 96.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.18% | 99.15% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.15% | 98.75% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.53% | 83.82% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.82% | 93.10% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.45% | 97.14% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.33% | 92.29% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 86.24% | 82.86% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.12% | 98.10% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 85.77% | 88.10% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.51% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.34% | 96.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.89% | 85.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.13% | 98.05% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 82.73% | 96.28% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 82.68% | 98.94% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.61% | 91.19% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.48% | 94.08% |
| CHEMBL2163183 | Q9NXA8 | NAD-dependent protein deacylase sirtuin-5, mitochondrial | 81.95% | 96.53% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.78% | 94.73% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.53% | 94.62% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.53% | 96.03% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 80.51% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.42% | 89.63% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.14% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10441376 |
| LOTUS | LTS0209333 |
| wikiData | Q105194742 |