Tyr-Ile
| Internal ID | 2cbcdb8d-fc5b-4055-8491-a0bcdb5ec33f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)O)NC(=O)C(CC1=CC=C(C=C1)O)N |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)N |
| InChI | InChI=1S/C15H22N2O4/c1-3-9(2)13(15(20)21)17-14(19)12(16)8-10-4-6-11(18)7-5-10/h4-7,9,12-13,18H,3,8,16H2,1-2H3,(H,17,19)(H,20,21)/t9-,12-,13-/m0/s1 |
| InChI Key | QJKMCQRFHJRIPU-XDTLVQLUSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15795719 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -1.80 |
| Tyr-Ile |
| 40829-32-1 |
| L-TYROSYL-L-ISOLEUCINE |
| Tyrosyl-Isoleucine |
| tyrosylisoleucine |
| CHEBI:74993 |
| (2S,3S)-2-((S)-2-Amino-3-(4-hydroxyphenyl)Propanamido)-3-methylpentanoic acid |
| L-Tyr-L-Ile |
| CHEMBL299835 |
| SCHEMBL9822685 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.25% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.71% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.43% | 97.21% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.99% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.83% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.21% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.78% | 93.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.78% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.77% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.05% | 92.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.77% | 96.95% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.41% | 95.50% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 86.77% | 97.23% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 85.88% | 91.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.17% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 83.35% | 90.24% |
| CHEMBL4072 | P07858 | Cathepsin B | 83.17% | 93.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.19% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.49% | 91.19% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.28% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.22% | 90.71% |
| CHEMBL236 | P41143 | Delta opioid receptor | 80.14% | 99.35% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 7019110 |
| LOTUS | LTS0213594 |
| wikiData | Q27145058 |