Turkiyenine
Internal ID | c7cb8ba5-aeb9-42b3-8f8a-926de604c6e5 |
Taxonomy | Organoheterocyclic compounds > Benzazepines |
IUPAC Name | 7'-methylspiro[7H-furo[3,2-g][1,3]benzodioxole-6,6'-[1,3]dioxolo[4,5-h][3]benzazepine]-5'-one |
SMILES (Canonical) | CN1C=CC2=CC3=C(C=C2C(=O)C14COC5=C4C=CC6=C5OCO6)OCO3 |
SMILES (Isomeric) | CN1C=CC2=CC3=C(C=C2C(=O)C14COC5=C4C=CC6=C5OCO6)OCO3 |
InChI | InChI=1S/C20H15NO6/c1-21-5-4-11-6-15-16(26-9-25-15)7-12(11)19(22)20(21)8-23-17-13(20)2-3-14-18(17)27-10-24-14/h2-7H,8-10H2,1H3 |
InChI Key | OSHWDBDJVMRZTD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H15NO6 |
Molecular Weight | 365.30 g/mol |
Exact Mass | 365.08993720 g/mol |
Topological Polar Surface Area (TPSA) | 66.50 Ų |
XlogP | 3.00 |
Turkiyenine |
Turkiye nine |
7-methylspiro[1,3-dioxolo[4,5-h][3]benzazepine-6,6'-furo[2,3-e][1,3]benzodioxol]-5(7h)-one |
(+)-Turkiyenine |
DTXSID90919293 |
7-Methyl-2H,2'H,7'H-spiro[1,3-dioxolo[4,5-h][3]benzazepine-6,6'-furo[2,3-e][1,3]benzodioxol]-5(7H)-one |
Spiro(6H-1,3-dioxolo(4,5-h)(3)benzazepine-6,6'(7'H)-furo(2,3-e)(1,3)benzodioxol)-5(7H)-one, 7-methyl-, (+)- |
![2D Structure of Turkiyenine 2D Structure of Turkiyenine](https://plantaedb.com/storage/docs/compounds/2023/11/turkiyenine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 99.36% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 97.14% | 98.95% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 96.45% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.17% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 91.87% | 90.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.17% | 82.69% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.11% | 96.09% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 90.36% | 94.80% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.20% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.16% | 91.49% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.68% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.01% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.76% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.20% | 86.33% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.75% | 94.42% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 81.04% | 93.99% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.03% | 89.00% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.02% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chelidonium majus |
Hypecoum imberbe |
Hypecoum pendulum |
Hypecoum procumbens |
PubChem | 185158 |
LOTUS | LTS0239707 |
wikiData | Q82891777 |