Trp-Ala
| Internal ID | 1626484b-a7db-4efb-a999-58bfe337d7f7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]propanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,11-/m0/s1 |
| InChI Key | OHGNSVACHBZKSS-KWQFWETISA-N |
| Popularity | 28 references in papers |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12699141 g/mol |
| Topological Polar Surface Area (TPSA) | 108.00 Ų |
| XlogP | -2.00 |
| Trp-Ala |
| 24046-71-7 |
| L-tryptophyl-L-alanine |
| tryptophylalanine |
| CHEMBL188866 |
| CHEBI:73710 |
| (S)-2-((S)-2-amino-3-(1H-indol-3-yl)propanamido)propanoic acid |
| Tryptophanyl-alanine |
| L-Trp-L-Ala |
| L-Tryptophanyl-L-alanine |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.07% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.27% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.69% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.55% | 90.20% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.23% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 89.50% | 90.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.69% | 89.62% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.76% | 98.75% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.55% | 100.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.24% | 83.10% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.46% | 94.62% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.07% | 88.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.18% | 97.23% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.15% | 92.29% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 81.96% | 95.48% |
| CHEMBL5028 | O14672 | ADAM10 | 81.52% | 97.50% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.33% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.05% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6993401 |
| LOTUS | LTS0125141 |
| wikiData | Q27144060 |