Trisorbicillinone B
| Internal ID | fbff603f-7c84-45ff-939b-ac9c12a1442a |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Cyclic ketones > Cyclohexenones |
| IUPAC Name | (4S,4aR,5aS,9aR,9bR)-4,4a,8-trihydroxy-2-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-9-[(E)-1-hydroxy-3-[(1R,2S,3S,4S,5S)-5-hydroxy-8-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-1,3,5-trimethyl-6,7-dioxo-2-bicyclo[2.2.2]octanyl]prop-2-enylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-1,3,6-trione |
| SMILES (Canonical) | CC=CC=CC(=C1C2C(C(C(C1=O)(C(=O)C2(C)O)C)C=CC(=C3C4C5(C(=O)C(=C(C=CC=CC)O)C(=O)C(C5(OC4(C(=O)C(=C3O)C)C)O)(C)O)C)O)C)O |
| SMILES (Isomeric) | C/C=C/C=C/C(=C1[C@@H]2[C@H]([C@@H]([C@](C1=O)(C(=O)[C@@]2(C)O)C)/C=C/C(=C3[C@@H]4[C@@]5(C(=O)C(=C(/C=C/C=C/C)O)C(=O)[C@]([C@@]5(O[C@@]4(C(=O)C(=C3O)C)C)O)(C)O)C)O)C)O |
| InChI | InChI=1S/C42H48O13/c1-10-12-14-16-23(43)26-29-20(3)22(37(5,33(26)48)36(51)39(29,7)52)18-19-25(45)27-30(46)21(4)32(47)40(8)31(27)38(6)34(49)28(24(44)17-15-13-11-2)35(50)41(9,53)42(38,54)55-40/h10-20,22,29,31,43-46,52-54H,1-9H3/b12-10+,13-11+,16-14+,17-15+,19-18+,26-23?,27-25?,28-24?/t20-,22-,29-,31+,37+,38+,39-,40-,41-,42+/m0/s1 |
| InChI Key | MPYCEVVCKUKTDZ-XQFKMQKHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C42H48O13 |
| Molecular Weight | 760.80 g/mol |
| Exact Mass | 760.30949158 g/mol |
| Topological Polar Surface Area (TPSA) | 236.00 Ų |
| XlogP | 4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.86% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.68% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.36% | 89.00% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 90.76% | 95.69% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.11% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.56% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.37% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.75% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.98% | 85.14% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 87.64% | 85.30% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.08% | 91.71% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.22% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139584615 |
| LOTUS | LTS0133944 |
| wikiData | Q77372373 |