Trigofoenoside D-1
Internal ID | d10a78b0-16d1-4752-b1dd-672152a2dcea |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3R,4S,5S,6R)-5-hydroxy-6-(hydroxymethyl)-2-[[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)OC7C(C(C(C(O7)CO)O)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C)OC1(CCC(C)COC9C(C(C(C(O9)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)CO)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)C)O)O)O)C)C)O[C@@]1(CC[C@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)OC |
InChI | InChI=1S/C52H86O23/c1-21(20-67-46-41(63)39(61)35(57)30(17-53)70-46)9-14-52(66-6)22(2)33-29(75-52)16-28-26-8-7-24-15-25(10-12-50(24,4)27(26)11-13-51(28,33)5)69-49-45(74-47-42(64)38(60)34(56)23(3)68-47)44(37(59)32(19-55)72-49)73-48-43(65)40(62)36(58)31(18-54)71-48/h7,21-23,25-49,53-65H,8-20H2,1-6H3/t21-,22-,23+,25-,26+,27-,28-,29-,30+,31+,32+,33-,34+,35+,36+,37-,38-,39-,40-,41+,42+,43+,44-,45+,46+,47-,48-,49+,50-,51-,52+/m0/s1 |
InChI Key | LOSNTJHBTWBJCC-OCFNRMRNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C52H86O23 |
Molecular Weight | 1079.20 g/mol |
Exact Mass | 1078.55598899 g/mol |
Topological Polar Surface Area (TPSA) | 355.00 Ų |
XlogP | -0.70 |
There are no found synonyms. |
![2D Structure of Trigofoenoside D-1 2D Structure of Trigofoenoside D-1](https://plantaedb.com/storage/docs/compounds/2023/11/trigofoenoside-d-1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.06% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.37% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.62% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.97% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.83% | 100.00% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.35% | 94.08% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.71% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.45% | 93.56% |
CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.84% | 95.89% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 87.54% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.74% | 89.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.31% | 97.25% |
CHEMBL237 | P41145 | Kappa opioid receptor | 86.12% | 98.10% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.33% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.11% | 94.73% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 83.52% | 94.23% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.31% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.21% | 94.75% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.92% | 98.46% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.71% | 96.61% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.19% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.60% | 100.00% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.48% | 93.18% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.43% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.36% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.19% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dioscorea spongiosa |
PubChem | 163050700 |
LOTUS | LTS0075898 |
wikiData | Q105154894 |