Trideca-2,10,12-trien-4,6,8-triynyl acetate
| Internal ID | f92ded24-edd5-423c-973b-5d2fa5f22df6 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohol esters |
| IUPAC Name | trideca-2,10,12-trien-4,6,8-triynyl acetate |
| SMILES (Canonical) | CC(=O)OCC=CC#CC#CC#CC=CC=C |
| SMILES (Isomeric) | CC(=O)OCC=CC#CC#CC#CC=CC=C |
| InChI | InChI=1S/C15H12O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-15(2)16/h3-5,12-13H,1,14H2,2H3 |
| InChI Key | LAZFCCLGTKLHOX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.083729621 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.17% | 96.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.76% | 96.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 87.16% | 83.82% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.62% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.18% | 99.17% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 82.95% | 97.47% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.12% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Bidens andicola |
| Carlina acaulis |
| Carlina diae |
| Dahlia coccinea |
| Dahlia tubulata |
| PubChem | 92042445 |
| LOTUS | LTS0205530 |
| wikiData | Q105149104 |