Tricin 7-O-glucuronide
Internal ID | ce72d288-2563-4907-94eb-cf55c2cffb3b |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glucuronides > Flavonoid-7-O-glucuronides |
IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
SMILES (Canonical) | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)OC4C(C(C(C(O4)C(=O)O)O)O)O)O |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O |
InChI | InChI=1S/C23H22O13/c1-32-14-3-8(4-15(33-2)17(14)26)12-7-11(25)16-10(24)5-9(6-13(16)35-12)34-23-20(29)18(27)19(28)21(36-23)22(30)31/h3-7,18-21,23-24,26-29H,1-2H3,(H,30,31)/t18-,19-,20+,21-,23+/m0/s1 |
InChI Key | HJWFFBNADKDQPV-KHYDEXNFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H22O13 |
Molecular Weight | 506.40 g/mol |
Exact Mass | 506.10604075 g/mol |
Topological Polar Surface Area (TPSA) | 202.00 Ų |
XlogP | 1.10 |
32769-02-1 |
7-GlcA tricin |
DTXSID501314314 |
AKOS040744199 |
HY-111812 |
CS-0092630 |
Q63408672 |
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.92% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.99% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.13% | 89.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.74% | 90.71% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.99% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.46% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.98% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 91.19% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.45% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.92% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.38% | 97.36% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.62% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.24% | 90.71% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.47% | 99.23% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.88% | 94.73% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.73% | 96.09% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.60% | 95.50% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.52% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Medicago sativa |
Medicago truncatula |
PubChem | 101939793 |
LOTUS | LTS0221525 |
wikiData | Q63408672 |