Trichurusin B
| Internal ID | 19f1045f-fc36-4019-a946-b7f9b3eb04f8 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | [2-[(E)-4,6-dimethyloct-6-en-2-yl]-6-oxooxan-3-yl] (2E,4E)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate |
| SMILES (Canonical) | CC=C(C)CC(C)CC(C)C1C(CCC(=O)O1)OC(=O)C=CC(=CC(CCO)CO)C |
| SMILES (Isomeric) | C/C=C(\C)/CC(C)CC(C)C1C(CCC(=O)O1)OC(=O)/C=C/C(=C/C(CCO)CO)/C |
| InChI | InChI=1S/C25H40O6/c1-6-17(2)13-19(4)14-20(5)25-22(8-10-24(29)31-25)30-23(28)9-7-18(3)15-21(16-27)11-12-26/h6-7,9,15,19-22,25-27H,8,10-14,16H2,1-5H3/b9-7+,17-6+,18-15+ |
| InChI Key | OCXVGVTWMGMEPW-DVYBMHRESA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28248899 g/mol |
| Topological Polar Surface Area (TPSA) | 93.10 Ų |
| XlogP | 4.90 |
| [2-[(E)-4,6-dimethyloct-6-en-2-yl]-6-oxooxan-3-yl] (2E,4E)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate |
| (2-((E)-4,6-dimethyloct-6-en-2-yl)-6-oxooxan-3-yl) (2E,4E)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoate |
| 2-((6E)-4,6-Dimethyloct-6-en-2-yl)-6-oxooxan-3-yl (2E,4E)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoic acid |
| 2-[(6E)-4,6-Dimethyloct-6-en-2-yl]-6-oxooxan-3-yl (2E,4E)-8-hydroxy-6-(hydroxymethyl)-4-methylocta-2,4-dienoic acid |
| RefChem:191336 |
| 867183-03-7 |
| CHEBI:203260 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.11% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.11% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.04% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.96% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.17% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.38% | 94.45% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.91% | 94.66% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.90% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.39% | 95.56% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 83.97% | 96.47% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.71% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 82.53% | 98.10% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.97% | 98.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.35% | 97.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.03% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11178088 |
| LOTUS | LTS0124476 |
| wikiData | Q77376493 |