Trichovirin II 6a
| Internal ID | 724d983e-d1e4-4b56-9f98-aa5778ce5e50 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[[2-[[2-[[2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]acetyl]amino]propanoylamino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylbutanoyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-2-methylbutanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-N-(1-hydroxy-4-methylpentan-2-yl)pentanediamide |
| SMILES (Canonical) | CCC(C)(C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(CC)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CCC(C)(C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(CC)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C82H144N20O21/c1-27-81(25,99-62(111)51(32-34-57(84)106)92-69(118)77(17,18)97-63(112)52(37-44(5)6)89-60(109)47(11)87-58(107)40-85-67(116)75(13,14)94-48(12)104)72(121)93-54(39-46(9)10)65(114)96-76(15,16)68(117)86-41-59(108)95-82(26,28-2)73(122)101-80(23,24)74(123)102-35-29-30-55(102)66(115)90-53(38-45(7)8)64(113)98-79(21,22)71(120)100-78(19,20)70(119)91-50(31-33-56(83)105)61(110)88-49(42-103)36-43(3)4/h43-47,49-55,103H,27-42H2,1-26H3,(H2,83,105)(H2,84,106)(H,85,116)(H,86,117)(H,87,107)(H,88,110)(H,89,109)(H,90,115)(H,91,119)(H,92,118)(H,93,121)(H,94,104)(H,95,108)(H,96,114)(H,97,112)(H,98,113)(H,99,111)(H,100,120)(H,101,122) |
| InChI Key | OQACGHMNWFHRBW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C82H144N20O21 |
| Molecular Weight | 1746.10 g/mol |
| Exact Mass | 1745.08149168 g/mol |
| Topological Polar Surface Area (TPSA) | 621.00 Ų |
| XlogP | 0.00 |
| Atomic LogP (AlogP) | -2.71 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 51 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8495 | 84.95% |
| Caco-2 | - | 0.8585 | 85.85% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.6286 | 62.86% |
| Subcellular localzation | Lysosomes | 0.6420 | 64.20% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8487 | 84.87% |
| OATP1B3 inhibitior | + | 0.9384 | 93.84% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9640 | 96.40% |
| P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
| P-glycoprotein substrate | + | 0.8615 | 86.15% |
| CYP3A4 substrate | + | 0.7364 | 73.64% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.6717 | 67.17% |
| CYP2C9 inhibition | - | 0.8930 | 89.30% |
| CYP2C19 inhibition | - | 0.7785 | 77.85% |
| CYP2D6 inhibition | - | 0.8905 | 89.05% |
| CYP1A2 inhibition | - | 0.9260 | 92.60% |
| CYP2C8 inhibition | + | 0.6076 | 60.76% |
| CYP inhibitory promiscuity | - | 0.9759 | 97.59% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7900 | 79.00% |
| Carcinogenicity (trinary) | Non-required | 0.6172 | 61.72% |
| Eye corrosion | - | 0.9794 | 97.94% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7867 | 78.67% |
| Skin corrosion | - | 0.8821 | 88.21% |
| Ames mutagenesis | - | 0.6678 | 66.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6811 | 68.11% |
| Micronuclear | + | 0.5900 | 59.00% |
| Hepatotoxicity | - | 0.5093 | 50.93% |
| skin sensitisation | - | 0.8896 | 88.96% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.7509 | 75.09% |
| Acute Oral Toxicity (c) | III | 0.6602 | 66.02% |
| Estrogen receptor binding | - | 0.5142 | 51.42% |
| Androgen receptor binding | + | 0.7606 | 76.06% |
| Thyroid receptor binding | + | 0.7287 | 72.87% |
| Glucocorticoid receptor binding | + | 0.8040 | 80.40% |
| Aromatase binding | + | 0.7905 | 79.05% |
| PPAR gamma | + | 0.7824 | 78.24% |
| Honey bee toxicity | - | 0.7544 | 75.44% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5024 | 50.24% |
| Fish aquatic toxicity | - | 0.4793 | 47.93% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.77% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.64% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.32% | 96.61% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 99.12% | 95.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 99.08% | 89.63% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.60% | 98.94% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.57% | 98.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.15% | 96.09% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.12% | 99.35% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.98% | 96.67% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 97.32% | 99.77% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.26% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.99% | 98.05% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.35% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.23% | 98.10% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 96.20% | 96.03% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.85% | 82.69% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.71% | 100.00% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 95.70% | 92.38% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.54% | 98.24% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 95.52% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.27% | 95.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.00% | 91.19% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.86% | 96.47% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 94.52% | 95.71% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 94.50% | 86.67% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 94.04% | 97.43% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 93.93% | 98.89% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.79% | 97.64% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.79% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.79% | 97.09% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 93.72% | 96.67% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.71% | 97.29% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.64% | 97.14% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 92.81% | 96.28% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.58% | 94.66% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 92.45% | 97.47% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.26% | 93.10% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.26% | 90.08% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 91.60% | 94.00% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 91.44% | 83.14% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 91.39% | 91.81% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.19% | 97.23% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.90% | 83.10% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 90.60% | 98.33% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 89.79% | 97.50% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.53% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.55% | 91.11% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.22% | 96.90% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.12% | 95.36% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 87.87% | 92.12% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.82% | 94.33% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 87.38% | 93.33% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 87.27% | 87.16% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.23% | 94.45% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 87.11% | 97.50% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 87.06% | 97.64% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 86.69% | 95.27% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.26% | 92.86% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.21% | 95.17% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 86.05% | 88.42% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 85.92% | 94.05% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.59% | 90.71% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.17% | 93.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 85.09% | 98.77% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.96% | 96.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.92% | 99.17% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 84.90% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.46% | 96.95% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.21% | 96.67% |
| CHEMBL4198 | P98170 | Inhibitor of apoptosis protein 3 | 84.19% | 97.79% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.11% | 98.75% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 84.09% | 82.38% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 83.64% | 95.00% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 83.50% | 88.81% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.09% | 95.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.07% | 96.00% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.30% | 96.31% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.25% | 95.89% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.16% | 92.50% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.75% | 95.83% |
| CHEMBL3691 | Q13822 | Autotaxin | 80.52% | 96.39% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.41% | 92.88% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 80.34% | 98.00% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 80.04% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85138387 |
| LOTUS | LTS0155556 |
| wikiData | Q75062329 |