Trichovirin II 4b
| Internal ID | 082f560b-5b4d-45ea-ad55-5327c0f5d914 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[[2-[[2-[[2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]acetyl]amino]propanoylamino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-2-methylbutanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-N-(1-hydroxy-4-methylpentan-2-yl)pentanediamide |
| SMILES (Canonical) | CCC(C)(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CCC(C)(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C80H140N20O21/c1-27-80(26,71(120)99-79(24,25)72(121)100-34-28-29-52(100)63(112)88-51(37-43(6)7)62(111)96-78(22,23)70(119)98-77(20,21)68(117)89-48(30-32-53(81)103)59(108)86-47(40-101)35-41(2)3)93-56(106)39-84-66(115)74(14,15)97-64(113)57(44(8)9)91-69(118)76(18,19)94-60(109)49(31-33-54(82)104)90-67(116)75(16,17)95-61(110)50(36-42(4)5)87-58(107)45(10)85-55(105)38-83-65(114)73(12,13)92-46(11)102/h41-45,47-52,57,101H,27-40H2,1-26H3,(H2,81,103)(H2,82,104)(H,83,114)(H,84,115)(H,85,105)(H,86,108)(H,87,107)(H,88,112)(H,89,117)(H,90,116)(H,91,118)(H,92,102)(H,93,106)(H,94,109)(H,95,110)(H,96,111)(H,97,113)(H,98,119)(H,99,120) |
| InChI Key | LECFSSLMASPBHF-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C80H140N20O21 |
| Molecular Weight | 1718.10 g/mol |
| Exact Mass | 1717.05019156 g/mol |
| Topological Polar Surface Area (TPSA) | 621.00 Ų |
| XlogP | -0.90 |
| Atomic LogP (AlogP) | -3.49 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 49 |
| RefChem:191332 |
| 2-((1-hydroxy-2-((1-hydroxy-2-((1-hydroxy-2-((1-hydroxy-2-((1-hydroxy-2-((1-hydroxyethylidene)amino)-2-methylpropylidene)amino)ethylidene)amino)propylidene)amino)-4-methylpentylidene)amino)-2-methylpropylidene)amino)-N-(1-((1-((1-((((1-((1-(2-((1-((1-((1-((1-((1-hydroxy-4-methylpentan-2-yl)-C-hydroxycarbonimidoyl)-3-(C-hydroxycarbonimidoyl)propyl)-C-hydroxycarbonimidoyl)-1-methylethyl)-C-hydroxycarbonimidoyl)-1-methylethyl)-C-hydroxycarbonimidoyl)-3-methylbutyl)-C-hydroxycarbonimidoyl)pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl)-C-hydroxycarbonimidoyl)-1-methylpropyl)-C-hydroxycarbonimidoyl)methyl)-C-hydroxycarbonimidoyl)-1-methylethyl)-C-hydroxycarbonimidoyl)-2-methylpropyl)-C-hydroxycarbonimidoyl)-1-methylethyl)pentanediimidate |
| 2-((2-((2-((2-((1-(2-((2-((2-((2-((2-((2-((2-((2-((2-(2-((2-((2-acetamido-2-methylpropanoyl)amino)acetyl)amino)propanoylamino)-4-methylpentanoyl)amino)-2-methylpropanoyl)amino)-5-amino-5-oxopentanoyl)amino)-2-methylpropanoyl)amino)-3-methylbutanoyl)amino)-2-methylpropanoyl)amino)acetyl)amino)-2-methylbutanoyl)amino)-2-methylpropanoyl)pyrrolidine-2-carbonyl)amino)-4-methylpentanoyl)amino)-2-methylpropanoyl)amino)-2-methylpropanoyl)amino)-N-(1-hydroxy-4-methylpentan-2-yl)pentanediamide |
| 2-[[2-[[2-[[2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]acetyl]amino]propanoylamino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-2-methylbutanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-N-(1-hydroxy-4-methylpentan-2-yl)pentanediamide |
| 2-{[1-hydroxy-2-({1-hydroxy-2-[(1-hydroxy-2-{[1-hydroxy-2-({1-hydroxy-2-[(1-hydroxyethylidene)amino]-2-methylpropylidene}amino)ethylidene]amino}propylidene)amino]-4-methylpentylidene}amino)-2-methylpropylidene]amino}-N-(1-{[1-({1-[({[1-({1-[2-({1-[(1-{[1-({1-[(1-hydroxy-4-methylpentan-2-yl)-C-hydroxycarbonimidoyl]-3-(C-hydroxycarbonimidoyl)propyl}-C-hydroxycarbonimidoyl)-1-methylethyl]-C-hydroxycarbonimidoyl}-1-methylethyl)-C-hydroxycarbonimidoyl]-3-methylbutyl}-C-hydroxycarbonimidoyl)pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl}-C-hydroxycarbonimidoyl)-1-methylpropyl]-C-hydroxycarbonimidoyl}methyl)-C-hydroxycarbonimidoyl]-1-methylethyl}-C-hydroxycarbonimidoyl)-2-methylpropyl]-C-hydroxycarbonimidoyl}-1-methylethyl)pentanediimidate |
| CHEBI:214497 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8495 | 84.95% |
| Caco-2 | - | 0.8585 | 85.85% |
| Blood Brain Barrier | - | 0.6250 | 62.50% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Lysosomes | 0.6420 | 64.20% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8405 | 84.05% |
| OATP1B3 inhibitior | + | 0.9384 | 93.84% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9540 | 95.40% |
| P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
| P-glycoprotein substrate | + | 0.8670 | 86.70% |
| CYP3A4 substrate | + | 0.7385 | 73.85% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.6717 | 67.17% |
| CYP2C9 inhibition | - | 0.8930 | 89.30% |
| CYP2C19 inhibition | - | 0.7785 | 77.85% |
| CYP2D6 inhibition | - | 0.8905 | 89.05% |
| CYP1A2 inhibition | - | 0.9260 | 92.60% |
| CYP2C8 inhibition | + | 0.6544 | 65.44% |
| CYP inhibitory promiscuity | - | 0.9759 | 97.59% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7900 | 79.00% |
| Carcinogenicity (trinary) | Non-required | 0.6172 | 61.72% |
| Eye corrosion | - | 0.9794 | 97.94% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7867 | 78.67% |
| Skin corrosion | - | 0.8821 | 88.21% |
| Ames mutagenesis | - | 0.6578 | 65.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6902 | 69.02% |
| Micronuclear | + | 0.5900 | 59.00% |
| Hepatotoxicity | - | 0.5093 | 50.93% |
| skin sensitisation | - | 0.8896 | 88.96% |
| Respiratory toxicity | + | 0.7667 | 76.67% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.6925 | 69.25% |
| Acute Oral Toxicity (c) | III | 0.6602 | 66.02% |
| Estrogen receptor binding | - | 0.5281 | 52.81% |
| Androgen receptor binding | + | 0.7567 | 75.67% |
| Thyroid receptor binding | + | 0.7258 | 72.58% |
| Glucocorticoid receptor binding | + | 0.8107 | 81.07% |
| Aromatase binding | + | 0.7962 | 79.62% |
| PPAR gamma | + | 0.7983 | 79.83% |
| Honey bee toxicity | - | 0.7435 | 74.35% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | + | 0.5124 | 51.24% |
| Fish aquatic toxicity | - | 0.4793 | 47.93% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.84% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.75% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.63% | 96.61% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 99.12% | 98.94% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.93% | 95.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.85% | 98.33% |
| CHEMBL236 | P41143 | Delta opioid receptor | 98.13% | 99.35% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 97.88% | 89.63% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.79% | 96.67% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 97.67% | 92.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.58% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.52% | 96.09% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 97.47% | 99.77% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.45% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.38% | 98.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.34% | 98.05% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.29% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 96.13% | 96.03% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 96.01% | 97.43% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.94% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.68% | 95.38% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.65% | 94.66% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.54% | 96.47% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.49% | 98.24% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 94.87% | 98.89% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 94.72% | 95.71% |
| CHEMBL2664 | P23526 | Adenosylhomocysteinase | 94.50% | 86.67% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.49% | 91.19% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 94.31% | 94.00% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 94.23% | 96.28% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.21% | 97.09% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.18% | 96.67% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.06% | 82.69% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.02% | 97.29% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.79% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.62% | 97.14% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 93.15% | 83.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.85% | 90.08% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.52% | 97.64% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 91.97% | 97.47% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.86% | 97.23% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.85% | 95.17% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.59% | 93.10% |
| CHEMBL4801 | P29466 | Caspase-1 | 91.42% | 96.85% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 91.19% | 88.42% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 91.09% | 97.50% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.59% | 83.10% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 90.45% | 98.33% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 89.66% | 92.12% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 89.65% | 97.29% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.53% | 100.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 89.02% | 96.90% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 88.95% | 96.31% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.74% | 97.50% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 88.73% | 87.16% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 88.72% | 93.33% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 87.97% | 95.36% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.86% | 91.11% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.82% | 94.33% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.21% | 91.81% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.85% | 92.86% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 86.52% | 97.64% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.37% | 90.71% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 86.30% | 95.27% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.15% | 93.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 86.04% | 98.77% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 85.25% | 94.05% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.20% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.17% | 99.17% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.96% | 96.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.92% | 95.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.75% | 96.00% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.53% | 96.67% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 84.43% | 96.25% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.33% | 97.21% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 84.30% | 92.80% |
| CHEMBL3468 | P55210 | Caspase-7 | 84.26% | 95.68% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.12% | 95.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.97% | 98.75% |
| CHEMBL3691 | Q13822 | Autotaxin | 83.23% | 96.39% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.97% | 95.83% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 82.92% | 89.33% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 82.63% | 81.29% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.59% | 98.46% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 82.49% | 99.17% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.00% | 82.38% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.93% | 95.89% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 81.57% | 88.81% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.42% | 97.06% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.07% | 89.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.19% | 90.17% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 80.09% | 99.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586016 |
| LOTUS | LTS0254263 |
| wikiData | Q77497003 |