Trichovirin II 3a
Internal ID | 6f9e5e3b-13c7-4c71-993a-a196ae2beaea |
Taxonomy | Organic Polymers > Polypeptides |
IUPAC Name | 2-[[2-[[2-[[2-[[1-[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]acetyl]amino]propanoylamino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylbutanoyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-N-(1-hydroxy-4-methylpentan-2-yl)pentanediamide |
SMILES (Canonical) | CCC(C)(C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
SMILES (Isomeric) | CCC(C)(C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |
InChI | InChI=1S/C80H140N20O21/c1-27-80(26,97-60(109)49(31-33-54(82)104)90-67(116)75(16,17)94-61(110)50(36-42(4)5)87-58(107)45(10)85-55(105)38-83-65(114)73(12,13)92-46(11)102)71(120)91-57(44(8)9)64(113)96-74(14,15)66(115)84-39-56(106)93-77(20,21)69(118)99-79(24,25)72(121)100-34-28-29-52(100)63(112)88-51(37-43(6)7)62(111)95-78(22,23)70(119)98-76(18,19)68(117)89-48(30-32-53(81)103)59(108)86-47(40-101)35-41(2)3/h41-45,47-52,57,101H,27-40H2,1-26H3,(H2,81,103)(H2,82,104)(H,83,114)(H,84,115)(H,85,105)(H,86,108)(H,87,107)(H,88,112)(H,89,117)(H,90,116)(H,91,120)(H,92,102)(H,93,106)(H,94,110)(H,95,111)(H,96,113)(H,97,109)(H,98,119)(H,99,118) |
InChI Key | ZXDDOBWNYWMQMH-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C80H140N20O21 |
Molecular Weight | 1718.10 g/mol |
Exact Mass | 1717.05019156 g/mol |
Topological Polar Surface Area (TPSA) | 621.00 Ų |
XlogP | -0.90 |
Atomic LogP (AlogP) | -3.49 |
H-Bond Acceptor | 21 |
H-Bond Donor | 20 |
Rotatable Bonds | 49 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7878 | 78.78% |
Caco-2 | - | 0.8585 | 85.85% |
Blood Brain Barrier | - | 0.6250 | 62.50% |
Human oral bioavailability | - | 0.6286 | 62.86% |
Subcellular localzation | Lysosomes | 0.6588 | 65.88% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8422 | 84.22% |
OATP1B3 inhibitior | + | 0.9413 | 94.13% |
MATE1 inhibitior | - | 0.9412 | 94.12% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | + | 0.9599 | 95.99% |
P-glycoprotein inhibitior | + | 0.7422 | 74.22% |
P-glycoprotein substrate | + | 0.8686 | 86.86% |
CYP3A4 substrate | + | 0.7397 | 73.97% |
CYP2C9 substrate | - | 0.7929 | 79.29% |
CYP2D6 substrate | - | 0.8494 | 84.94% |
CYP3A4 inhibition | - | 0.6096 | 60.96% |
CYP2C9 inhibition | - | 0.8953 | 89.53% |
CYP2C19 inhibition | - | 0.7752 | 77.52% |
CYP2D6 inhibition | - | 0.8874 | 88.74% |
CYP1A2 inhibition | - | 0.8923 | 89.23% |
CYP2C8 inhibition | + | 0.6683 | 66.83% |
CYP inhibitory promiscuity | - | 0.9687 | 96.87% |
UGT catelyzed | + | 0.7000 | 70.00% |
Carcinogenicity (binary) | - | 0.7900 | 79.00% |
Carcinogenicity (trinary) | Non-required | 0.6171 | 61.71% |
Eye corrosion | - | 0.9793 | 97.93% |
Eye irritation | - | 0.8955 | 89.55% |
Skin irritation | - | 0.7851 | 78.51% |
Skin corrosion | - | 0.8809 | 88.09% |
Ames mutagenesis | - | 0.6678 | 66.78% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6942 | 69.42% |
Micronuclear | + | 0.5800 | 58.00% |
Hepatotoxicity | + | 0.5032 | 50.32% |
skin sensitisation | - | 0.8834 | 88.34% |
Respiratory toxicity | + | 0.7778 | 77.78% |
Reproductive toxicity | + | 0.8000 | 80.00% |
Mitochondrial toxicity | + | 0.6625 | 66.25% |
Nephrotoxicity | - | 0.6820 | 68.20% |
Acute Oral Toxicity (c) | III | 0.6629 | 66.29% |
Estrogen receptor binding | - | 0.5223 | 52.23% |
Androgen receptor binding | + | 0.7567 | 75.67% |
Thyroid receptor binding | + | 0.7276 | 72.76% |
Glucocorticoid receptor binding | + | 0.8094 | 80.94% |
Aromatase binding | + | 0.7963 | 79.63% |
PPAR gamma | + | 0.7978 | 79.78% |
Honey bee toxicity | - | 0.7378 | 73.78% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5224 | 52.24% |
Fish aquatic toxicity | - | 0.6399 | 63.99% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.83% | 98.95% |
CHEMBL220 | P22303 | Acetylcholinesterase | 99.78% | 94.45% |
CHEMBL3837 | P07711 | Cathepsin L | 99.64% | 96.61% |
CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 99.18% | 98.94% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 98.85% | 98.33% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.84% | 95.00% |
CHEMBL236 | P41143 | Delta opioid receptor | 98.52% | 99.35% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.75% | 96.09% |
CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 97.60% | 92.38% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 97.58% | 93.56% |
CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 97.54% | 99.77% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.26% | 97.25% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 97.01% | 96.67% |
CHEMBL237 | P41145 | Kappa opioid receptor | 96.44% | 98.10% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.29% | 100.00% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.20% | 89.63% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.07% | 97.09% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.00% | 98.05% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.99% | 100.00% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 95.87% | 98.24% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.75% | 95.38% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.35% | 96.47% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.15% | 94.66% |
CHEMBL3176 | O43603 | Galanin receptor 2 | 94.87% | 98.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 94.72% | 91.19% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.62% | 96.03% |
CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 94.46% | 97.43% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 94.24% | 94.00% |
CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.22% | 96.67% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 94.08% | 95.71% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.98% | 97.14% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.82% | 97.29% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.79% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.78% | 82.69% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 93.62% | 97.64% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 93.59% | 86.67% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 93.57% | 83.14% |
CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 93.14% | 96.28% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.94% | 95.17% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.85% | 90.08% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 92.53% | 97.47% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 91.84% | 87.16% |
CHEMBL4801 | P29466 | Caspase-1 | 91.44% | 96.85% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.38% | 83.10% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.25% | 93.10% |
CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 91.09% | 97.50% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 91.04% | 97.23% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 90.61% | 97.64% |
CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 90.10% | 97.29% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 90.05% | 88.42% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.53% | 100.00% |
CHEMBL3018 | Q9Y5Y6 | Matriptase | 89.42% | 98.33% |
CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 88.96% | 96.31% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 88.91% | 97.50% |
CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 88.73% | 93.33% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 88.69% | 95.36% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.53% | 91.11% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.28% | 96.90% |
CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 87.93% | 92.12% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.76% | 94.33% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.21% | 93.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.80% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.71% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.50% | 96.00% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.11% | 91.81% |
CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 85.79% | 95.27% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.78% | 92.86% |
CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 85.65% | 98.77% |
CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 85.25% | 94.05% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.17% | 99.17% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.96% | 96.33% |
CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 84.90% | 92.80% |
CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 84.50% | 88.81% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 84.00% | 95.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 83.36% | 98.46% |
CHEMBL3468 | P55210 | Caspase-7 | 83.31% | 95.68% |
CHEMBL249 | P25103 | Neurokinin 1 receptor | 83.05% | 99.17% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.96% | 82.38% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.90% | 98.75% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 82.72% | 96.25% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.65% | 95.50% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.17% | 89.50% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.15% | 92.88% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 81.92% | 96.67% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.84% | 89.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.79% | 95.89% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.52% | 95.83% |
CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 81.27% | 99.00% |
CHEMBL3691 | Q13822 | Autotaxin | 80.90% | 96.39% |
CHEMBL3776 | Q14790 | Caspase-8 | 80.88% | 97.06% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ginkgo biloba |
PubChem | 139585512 |
LOTUS | LTS0245245 |
wikiData | Q105100810 |