Trichorovin-Vb
| Internal ID | 1827815f-4937-4629-a538-9b3b2dd7f2b5 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[(2-acetamido-2-methylpropanoyl)amino]-N-[1-[[1-[[1-[2-[[1-[[1-[[1-[2-[(1-hydroxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]butanediamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CO)C(C)C)NC(=O)C2CCCN2C(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CO)C(C)C)NC(=O)C2CCCN2C(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC(=O)N)NC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C57H100N12O13/c1-30(2)24-36(59-47(75)40(28-44(58)72)64-52(80)55(12,13)65-35(11)71)45(73)60-38(26-32(5)6)48(76)66-56(14,15)53(81)68-22-18-20-42(68)50(78)62-37(25-31(3)4)46(74)61-39(27-33(7)8)49(77)67-57(16,17)54(82)69-23-19-21-43(69)51(79)63-41(29-70)34(9)10/h30-34,36-43,70H,18-29H2,1-17H3,(H2,58,72)(H,59,75)(H,60,73)(H,61,74)(H,62,78)(H,63,79)(H,64,80)(H,65,71)(H,66,76)(H,67,77) |
| InChI Key | FQNMAOLKCZCGJN-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C57H100N12O13 |
| Molecular Weight | 1161.50 g/mol |
| Exact Mass | 1160.75328129 g/mol |
| Topological Polar Surface Area (TPSA) | 366.00 Ų |
| XlogP | 2.70 |
| Atomic LogP (AlogP) | 0.29 |
| H-Bond Acceptor | 13 |
| H-Bond Donor | 11 |
| Rotatable Bonds | 31 |
| RefChem:191255 |
| 2-((1-hydroxy-2-((1-hydroxyethylidene)amino)-2-methylpropylidene)amino)-N-(1-((1-((1-(2-((1-((1-((1-(2-((1-hydroxy-3-methylbutan-2-yl)-C-hydroxycarbonimidoyl)pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl)-C-hydroxycarbonimidoyl)-3-methylbutyl)-C-hydroxycarbonimidoyl)-3-methylbutyl)-C-hydroxycarbonimidoyl)pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl)-C-hydroxycarbonimidoyl)-3-methylbutyl)-C-hydroxycarbonimidoyl)-3-methylbutyl)butanediimidate |
| 2-((2-acetamido-2-methylpropanoyl)amino)-N-(1-((1-((1-(2-((1-((1-((1-(2-((1-hydroxy-3-methylbutan-2-yl)carbamoyl)pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamoyl)pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)butanediamide |
| 2-({1-hydroxy-2-[(1-hydroxyethylidene)amino]-2-methylpropylidene}amino)-N-{1-[(1-{[1-(2-{[1-({1-[(1-{2-[(1-hydroxy-3-methylbutan-2-yl)-C-hydroxycarbonimidoyl]pyrrolidin-1-yl}-2-methyl-1-oxopropan-2-yl)-C-hydroxycarbonimidoyl]-3-methylbutyl}-C-hydroxycarbonimidoyl)-3-methylbutyl]-C-hydroxycarbonimidoyl}pyrrolidin-1-yl)-2-methyl-1-oxopropan-2-yl]-C-hydroxycarbonimidoyl}-3-methylbutyl)-C-hydroxycarbonimidoyl]-3-methylbutyl}butanediimidate |
| 2-[(2-acetamido-2-methylpropanoyl)amino]-N-[1-[[1-[[1-[2-[[1-[[1-[[1-[2-[(1-hydroxy-3-methylbutan-2-yl)carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]pyrrolidin-1-yl]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]butanediamide |
| CHEBI:199022 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4868 | 48.68% |
| Caco-2 | - | 0.8601 | 86.01% |
| Blood Brain Barrier | - | 0.6750 | 67.50% |
| Human oral bioavailability | - | 0.5857 | 58.57% |
| Subcellular localzation | Lysosomes | 0.6841 | 68.41% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8938 | 89.38% |
| OATP1B3 inhibitior | + | 0.9340 | 93.40% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9387 | 93.87% |
| P-glycoprotein inhibitior | + | 0.7426 | 74.26% |
| P-glycoprotein substrate | + | 0.8048 | 80.48% |
| CYP3A4 substrate | + | 0.6917 | 69.17% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.8046 | 80.46% |
| CYP2C9 inhibition | - | 0.8726 | 87.26% |
| CYP2C19 inhibition | - | 0.8076 | 80.76% |
| CYP2D6 inhibition | - | 0.8875 | 88.75% |
| CYP1A2 inhibition | - | 0.9067 | 90.67% |
| CYP2C8 inhibition | - | 0.7157 | 71.57% |
| CYP inhibitory promiscuity | - | 0.9743 | 97.43% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7800 | 78.00% |
| Carcinogenicity (trinary) | Non-required | 0.6344 | 63.44% |
| Eye corrosion | - | 0.9797 | 97.97% |
| Eye irritation | - | 0.8966 | 89.66% |
| Skin irritation | - | 0.7668 | 76.68% |
| Skin corrosion | - | 0.8934 | 89.34% |
| Ames mutagenesis | - | 0.5900 | 59.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3917 | 39.17% |
| Micronuclear | + | 0.6400 | 64.00% |
| Hepatotoxicity | + | 0.5782 | 57.82% |
| skin sensitisation | - | 0.8504 | 85.04% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.7778 | 77.78% |
| Mitochondrial toxicity | + | 0.7000 | 70.00% |
| Nephrotoxicity | + | 0.4796 | 47.96% |
| Acute Oral Toxicity (c) | III | 0.6463 | 64.63% |
| Estrogen receptor binding | + | 0.6851 | 68.51% |
| Androgen receptor binding | + | 0.7476 | 74.76% |
| Thyroid receptor binding | + | 0.6008 | 60.08% |
| Glucocorticoid receptor binding | + | 0.6943 | 69.43% |
| Aromatase binding | + | 0.7237 | 72.37% |
| PPAR gamma | + | 0.7764 | 77.64% |
| Honey bee toxicity | - | 0.8505 | 85.05% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.7100 | 71.00% |
| Fish aquatic toxicity | - | 0.6004 | 60.04% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.42% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.05% | 96.61% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.05% | 96.09% |
| CHEMBL3468 | P55210 | Caspase-7 | 97.86% | 95.68% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.82% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 97.67% | 98.10% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.30% | 98.33% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 96.70% | 98.94% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.66% | 93.56% |
| CHEMBL4801 | P29466 | Caspase-1 | 95.50% | 96.85% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 95.01% | 94.66% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.93% | 98.24% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 94.77% | 96.03% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 94.46% | 92.38% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 94.40% | 96.67% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.14% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.88% | 97.14% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.85% | 97.50% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 92.58% | 92.12% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.50% | 100.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 92.46% | 95.38% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.36% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.29% | 96.47% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.11% | 97.64% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 91.87% | 83.10% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 91.66% | 96.31% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.61% | 91.19% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 91.34% | 94.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.30% | 96.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.05% | 97.09% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 90.81% | 97.43% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 90.32% | 98.89% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 90.09% | 96.67% |
| CHEMBL1801 | P00747 | Plasminogen | 88.27% | 92.44% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 88.24% | 99.77% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.55% | 94.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 87.54% | 92.80% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 87.45% | 83.14% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.97% | 90.71% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 84.89% | 93.33% |
| CHEMBL5028 | O14672 | ADAM10 | 84.70% | 97.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 84.69% | 98.05% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.68% | 97.47% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.51% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.34% | 95.89% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 84.03% | 90.08% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.79% | 93.00% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 83.67% | 95.27% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.57% | 90.93% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 83.52% | 97.29% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 83.47% | 98.77% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 83.37% | 98.57% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.26% | 100.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 82.88% | 88.42% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.53% | 95.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.52% | 90.24% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.35% | 97.56% |
| CHEMBL2334 | P42574 | Caspase-3 | 82.31% | 98.25% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.16% | 93.10% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.05% | 97.21% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.91% | 82.69% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 81.54% | 99.17% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.45% | 99.18% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.37% | 97.86% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 81.29% | 94.05% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.76% | 95.89% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.55% | 95.50% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.46% | 91.11% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.39% | 81.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139583578 |
| LOTUS | LTS0031802 |
| wikiData | Q75064086 |