Trichokindin-Ia
| Internal ID | f153352b-4651-4a27-a8fc-7e200c253448 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[[2-[[2-[[2-[[1-[2-[[2-[2-[[2-[[2-[[2-[[2-[[2-[[2-[2-[[2-[(2-acetamido-2-methylpropanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylbutanoyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]propanoylamino]-2-methylpropanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-N-(1-hydroxy-3-methylpentan-2-yl)pentanediamide |
| SMILES (Canonical) | CCC(C)C(CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C1CCCN1C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)(CC)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CCC(C)C(CO)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C1CCCN1C(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)(CC)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C81H142N20O22/c1-28-43(7)51(39-102)87-58(109)47(32-34-54(82)105)88-66(117)75(15,16)99-69(120)79(23,24)96-61(112)49(37-41(3)4)86-63(114)53-31-30-36-101(53)72(123)80(25,26)100-70(121)78(21,22)94-57(108)45(9)85-64(115)74(13,14)95-62(113)50(38-42(5)6)90-71(122)81(27,29-2)97-60(111)48(33-35-55(83)106)89-67(118)76(17,18)98-68(119)77(19,20)93-56(107)44(8)84-59(110)52(40-103)91-65(116)73(11,12)92-46(10)104/h41-45,47-53,102-103H,28-40H2,1-27H3,(H2,82,105)(H2,83,106)(H,84,110)(H,85,115)(H,86,114)(H,87,109)(H,88,117)(H,89,118)(H,90,122)(H,91,116)(H,92,104)(H,93,107)(H,94,108)(H,95,113)(H,96,112)(H,97,111)(H,98,119)(H,99,120)(H,100,121) |
| InChI Key | YKOPSLLSXHTJSA-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C81H142N20O22 |
| Molecular Weight | 1748.10 g/mol |
| Exact Mass | 1747.06075624 g/mol |
| Topological Polar Surface Area (TPSA) | 642.00 Ų |
| XlogP | -1.90 |
| Atomic LogP (AlogP) | -3.99 |
| H-Bond Acceptor | 22 |
| H-Bond Donor | 21 |
| Rotatable Bonds | 49 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6947 | 69.47% |
| Caco-2 | - | 0.8583 | 85.83% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Lysosomes | 0.7100 | 71.00% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8620 | 86.20% |
| OATP1B3 inhibitior | + | 0.9301 | 93.01% |
| MATE1 inhibitior | - | 0.9412 | 94.12% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9303 | 93.03% |
| P-glycoprotein inhibitior | + | 0.7420 | 74.20% |
| P-glycoprotein substrate | + | 0.8471 | 84.71% |
| CYP3A4 substrate | + | 0.7250 | 72.50% |
| CYP2C9 substrate | - | 0.7929 | 79.29% |
| CYP2D6 substrate | - | 0.8494 | 84.94% |
| CYP3A4 inhibition | - | 0.8248 | 82.48% |
| CYP2C9 inhibition | - | 0.8827 | 88.27% |
| CYP2C19 inhibition | - | 0.8331 | 83.31% |
| CYP2D6 inhibition | - | 0.8886 | 88.86% |
| CYP1A2 inhibition | - | 0.8861 | 88.61% |
| CYP2C8 inhibition | + | 0.5990 | 59.90% |
| CYP inhibitory promiscuity | - | 0.9694 | 96.94% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8100 | 81.00% |
| Carcinogenicity (trinary) | Non-required | 0.6223 | 62.23% |
| Eye corrosion | - | 0.9810 | 98.10% |
| Eye irritation | - | 0.8955 | 89.55% |
| Skin irritation | - | 0.7701 | 77.01% |
| Skin corrosion | - | 0.8983 | 89.83% |
| Ames mutagenesis | - | 0.7137 | 71.37% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6987 | 69.87% |
| Micronuclear | + | 0.6800 | 68.00% |
| Hepatotoxicity | + | 0.5782 | 57.82% |
| skin sensitisation | - | 0.8605 | 86.05% |
| Respiratory toxicity | + | 0.6889 | 68.89% |
| Reproductive toxicity | + | 0.8000 | 80.00% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.7091 | 70.91% |
| Acute Oral Toxicity (c) | III | 0.6710 | 67.10% |
| Estrogen receptor binding | - | 0.5145 | 51.45% |
| Androgen receptor binding | + | 0.7500 | 75.00% |
| Thyroid receptor binding | + | 0.7345 | 73.45% |
| Glucocorticoid receptor binding | + | 0.8043 | 80.43% |
| Aromatase binding | + | 0.7970 | 79.70% |
| PPAR gamma | + | 0.7856 | 78.56% |
| Honey bee toxicity | - | 0.7804 | 78.04% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6600 | 66.00% |
| Fish aquatic toxicity | - | 0.5441 | 54.41% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.81% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.50% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.54% | 96.09% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.49% | 94.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.19% | 93.56% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.01% | 98.94% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.95% | 98.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.35% | 98.24% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 96.52% | 97.43% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 96.49% | 99.77% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 95.89% | 95.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 95.72% | 91.19% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.38% | 100.00% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.21% | 89.63% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 95.11% | 96.47% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 95.07% | 92.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.93% | 97.09% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.85% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 94.67% | 100.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.36% | 98.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.16% | 98.05% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.52% | 96.03% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 93.08% | 96.67% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.91% | 82.69% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.60% | 97.25% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 92.56% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 92.35% | 97.14% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 91.92% | 97.64% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 91.82% | 94.66% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 91.63% | 93.33% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 91.47% | 96.67% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 91.13% | 95.71% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.41% | 92.86% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 90.29% | 83.14% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 90.18% | 97.64% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 89.69% | 98.89% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 89.44% | 96.31% |
| CHEMBL4801 | P29466 | Caspase-1 | 88.69% | 96.85% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 88.64% | 87.16% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.53% | 94.00% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.89% | 97.47% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.65% | 100.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.94% | 94.33% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 86.71% | 99.17% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 86.57% | 98.77% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.42% | 93.10% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.16% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.06% | 96.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.93% | 97.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.89% | 97.29% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 85.51% | 96.38% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 85.19% | 97.23% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.01% | 98.75% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 84.92% | 93.04% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.72% | 83.10% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.64% | 96.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.54% | 90.71% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 84.40% | 92.12% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.32% | 90.24% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.31% | 98.46% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.12% | 93.00% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.03% | 99.35% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.81% | 96.95% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 83.71% | 98.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.52% | 99.17% |
| CHEMBL1075145 | P55072 | Transitional endoplasmic reticulum ATPase | 83.40% | 98.50% |
| CHEMBL3238 | P23786 | Carnitine palmitoyltransferase 2 | 83.23% | 94.05% |
| CHEMBL4015 | P41597 | C-C chemokine receptor type 2 | 83.00% | 98.57% |
| CHEMBL2474 | P53582 | Methionine aminopeptidase 1 | 82.92% | 97.09% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.42% | 95.36% |
| CHEMBL249 | P25103 | Neurokinin 1 receptor | 82.34% | 99.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.28% | 95.50% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.20% | 96.21% |
| CHEMBL5028 | O14672 | ADAM10 | 81.90% | 97.50% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.69% | 99.18% |
| CHEMBL3691 | Q13822 | Autotaxin | 81.51% | 96.39% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.45% | 95.27% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.23% | 96.90% |
| CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 80.91% | 93.90% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.37% | 95.89% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 80.22% | 91.81% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 80.09% | 97.56% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 80.01% | 94.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588502 |
| LOTUS | LTS0207336 |
| wikiData | Q104201798 |