Tri-decylphenol
Internal ID | fe1e4f7e-9dd1-4033-beb0-2cf6ec1c7fb0 |
Taxonomy | Benzenoids > Phenols > 1-hydroxy-4-unsubstituted benzenoids |
IUPAC Name | 2-tridecylphenol |
SMILES (Canonical) | CCCCCCCCCCCCCC1=CC=CC=C1O |
SMILES (Isomeric) | CCCCCCCCCCCCCC1=CC=CC=C1O |
InChI | InChI=1S/C19H32O/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-16-13-14-17-19(18)20/h13-14,16-17,20H,2-12,15H2,1H3 |
InChI Key | RGVIYLQXUDJMCP-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C19H32O |
Molecular Weight | 276.50 g/mol |
Exact Mass | 276.245315640 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 8.30 |
Phenol, 2-tridecyl- |
96850-25-8 |
SCHEMBL252081 |
DTXSID20878460 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.21% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.08% | 98.95% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.12% | 92.08% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.81% | 89.63% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.09% | 96.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.03% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.87% | 94.73% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 87.37% | 96.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.70% | 86.33% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 85.71% | 91.81% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.00% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.07% | 99.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.34% | 97.79% |
CHEMBL240 | Q12809 | HERG | 80.96% | 89.76% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.40% | 92.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ginkgo biloba |
PubChem | 13847900 |
LOTUS | LTS0205663 |
wikiData | Q82860496 |