trans-Fertaric acid
Internal ID | 94b559d2-355c-4810-bcc5-10bb53ce75fb |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | (2R,3R)-2-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxybutanedioic acid |
SMILES (Canonical) | COC1=C(C=CC(=C1)C=CC(=O)OC(C(C(=O)O)O)C(=O)O)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)O[C@H]([C@H](C(=O)O)O)C(=O)O)O |
InChI | InChI=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+/t11-,12-/m1/s1 |
InChI Key | XIWXUSFCUBAMFH-WEPHUFDCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H14O9 |
Molecular Weight | 326.25 g/mol |
Exact Mass | 326.06378202 g/mol |
Topological Polar Surface Area (TPSA) | 151.00 Ų |
XlogP | 0.40 |
Fertaric acid |
(2R,3R)-trans-fertaric acid |
Feruloyltartaric acid |
74282-22-7 |
CHEBI:76116 |
AKOS040734423 |
Q27145763 |
(2R,3R)-2-hydroxy-3-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxybutanedioic acid |
(2R,3R)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.54% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.31% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 96.15% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.59% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.56% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.63% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.97% | 94.45% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 88.48% | 90.20% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.39% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.67% | 89.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.52% | 89.62% |
CHEMBL2581 | P07339 | Cathepsin D | 83.95% | 98.95% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.99% | 95.50% |
CHEMBL2535 | P11166 | Glucose transporter | 81.30% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vitis vinifera |
PubChem | 72551457 |
LOTUS | LTS0083116 |
wikiData | Q27145763 |