trans-2-(1-Hex-5-enyl)-5-(1-non-8-enyl) pyrrolidine
| Internal ID | a634cc02-6250-44cf-8cd5-8054462aeee8 |
| Taxonomy | Organoheterocyclic compounds > Pyrrolidines |
| IUPAC Name | (2S,5S)-2-hex-5-enyl-5-non-8-enylpyrrolidine |
| SMILES (Canonical) | C=CCCCCCCCC1CCC(N1)CCCCC=C |
| SMILES (Isomeric) | C=CCCCCCCC[C@H]1CC[C@@H](N1)CCCCC=C |
| InChI | InChI=1S/C19H35N/c1-3-5-7-9-10-11-13-15-19-17-16-18(20-19)14-12-8-6-4-2/h3-4,18-20H,1-2,5-17H2/t18-,19-/m0/s1 |
| InChI Key | YCQNSAJAZIVRFR-OALUTQOASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.276950121 g/mol |
| Topological Polar Surface Area (TPSA) | 12.00 Ų |
| XlogP | 6.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 95.28% | 95.92% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.36% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.77% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.53% | 96.09% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 85.94% | 94.55% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.57% | 97.05% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.34% | 93.99% |
| CHEMBL3975 | P09467 | Fructose-1,6-bisphosphatase | 85.31% | 92.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.26% | 91.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 85.11% | 90.08% |
| CHEMBL228 | P31645 | Serotonin transporter | 85.01% | 95.51% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.27% | 95.00% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.75% | 89.34% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 83.52% | 99.18% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.34% | 95.50% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.30% | 98.95% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.81% | 94.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.49% | 99.17% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.85% | 85.49% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 80.41% | 97.29% |
| CHEMBL1865 | Q9UBN7 | Histone deacetylase 6 | 80.30% | 97.03% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 129775854 |
| LOTUS | LTS0066256 |
| wikiData | Q105346421 |