Tragopogonsaponin B
Internal ID | d84d5aa3-8609-4893-996a-753c9414343e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,8R,8aR,12aS,14bR)-8a-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C)OC6C(C(C(C(O6)C(=O)O)O)O)O)C)C(=O)OC7C(C(C(CO7)O)O)OC(=O)C=CC8=CC=C(C=C8)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C(C1CC[C@@]3(C2CC=C4[C@]3(C[C@H]([C@@]5([C@H]4CC(CC5)(C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H](CO6)O)O)OC(=O)/C=C/C7=CC=C(C=C7)O)O)C)C)(C)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)C(=O)O)O)O)O |
InChI | InChI=1S/C50H70O16/c1-45(2)20-21-50(44(61)66-43-40(35(55)29(52)24-62-43)64-34(54)15-10-25-8-11-26(51)12-9-25)28(22-45)27-13-14-31-47(5)18-17-33(63-42-38(58)36(56)37(57)39(65-42)41(59)60)46(3,4)30(47)16-19-48(31,6)49(27,7)23-32(50)53/h8-13,15,28-33,35-40,42-43,51-53,55-58H,14,16-24H2,1-7H3,(H,59,60)/b15-10+/t28-,29+,30?,31?,32+,33-,35-,36-,37-,38+,39-,40+,42+,43-,47-,48+,49+,50+/m0/s1 |
InChI Key | WXQNYXVJRJEBPT-XLRBPNDWSA-N |
Popularity | 4 references in papers |
Molecular Formula | C50H70O16 |
Molecular Weight | 927.10 g/mol |
Exact Mass | 926.46638614 g/mol |
Topological Polar Surface Area (TPSA) | 259.00 Ų |
XlogP | 6.10 |
CHEBI:180890 |
(2S,3S,4S,5R,6R)-6-[[(3S,6aR,6bS,8R,8aR,12aS,14bR)-8a-[(2S,3R,4S,5R)-4,5-dihydroxy-3-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxyoxan-2-yl]oxycarbonyl-8-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.68% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.13% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.24% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.03% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.76% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.58% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.10% | 93.99% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.36% | 96.09% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 90.30% | 85.31% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 89.38% | 89.44% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 89.26% | 89.67% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 89.16% | 97.64% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.05% | 100.00% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.85% | 94.75% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 82.87% | 97.53% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.78% | 94.08% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.33% | 95.89% |
CHEMBL5028 | O14672 | ADAM10 | 81.13% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.07% | 93.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.29% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Tragopogon porrifolius |
PubChem | 131752253 |
LOTUS | LTS0132263 |
wikiData | Q105314859 |