Trachelanthine
Internal ID | 7056fe69-2a5e-469c-8513-6fcc50737a14 |
Taxonomy | Organoheterocyclic compounds > Pyrrolizidines |
IUPAC Name | [(1S,8S)-4-oxido-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
SMILES (Canonical) | CC(C)C(C(C)O)(C(=O)OCC1CC[N+]2(C1CCC2)[O-])O |
SMILES (Isomeric) | CC(C)[C@@](C(C)O)(C(=O)OC[C@H]1CC[N+]2([C@H]1CCC2)[O-])O |
InChI | InChI=1S/C15H27NO5/c1-10(2)15(19,11(3)17)14(18)21-9-12-6-8-16(20)7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11?,12-,13+,15-,16?/m1/s1 |
InChI Key | DLNWZIVYKQXLTN-CGYUPCHJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H27NO5 |
Molecular Weight | 301.38 g/mol |
Exact Mass | 301.18892296 g/mol |
Topological Polar Surface Area (TPSA) | 84.80 Ų |
XlogP | 0.80 |
510-19-0 |
Trachelanthamine oxide |
[(1S,8S)-4-oxido-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-yl]methyl (2R)-2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
Trachelanthamine N-oxide |
DTXSID90965275 |
AKOS040760030 |
Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, ((1R,7aS)-hexahydro-4-oxido-1H-pyrrolizin-1-yl)methyl ester, (2S,3R)- |
Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, (hexahydro-1H-pyrrolizin-1-yl)methyl ester, N-oxide, (1R-(1-alpha(2S*,3R*),7a-alpha))- |
(4-Oxooctahydro-4lambda~5~-pyrrolizin-1-yl)methyl 2-hydroxy-2-(1-hydroxyethyl)-3-methylbutanoate |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.42% | 97.25% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.64% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.92% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 95.56% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.40% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.74% | 97.09% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.82% | 93.03% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.51% | 96.47% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.15% | 95.56% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.69% | 94.00% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.08% | 83.82% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.94% | 91.11% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.06% | 89.34% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.87% | 92.88% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.74% | 93.04% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.06% | 98.05% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 81.81% | 97.47% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.68% | 95.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.39% | 95.89% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.15% | 98.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 80.12% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Trachelanthus korolkowii |
PubChem | 10523 |
LOTUS | LTS0077158 |
wikiData | Q82947470 |