Totopensamide C
| Internal ID | 334df374-c686-4e69-bf3d-2cd80bbea880 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | [5-[(2R,5S,11R,12R)-5-[(2S)-butan-2-yl]-12-[[(2S)-2-[[(2R,3R)-2-[[11-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]oxy-9,12-dihydroxy-4,6,8,10-tetramethyl-3-oxotridecanoyl]amino]-3-hydroxybutanoyl]amino]propanoyl]amino]-11-methyl-3,6,9,13-tetraoxo-1,4,7,10-tetrazacyclotridec-2-yl]-4-chloro-3-hydroxy-2-methylphenyl] hydrogen sulfate |
| SMILES (Canonical) | CCC(C)C1C(=O)NCC(=O)NC(C(C(=O)NC(C(=O)N1)C2=CC(=C(C(=C2Cl)O)C)OS(=O)(=O)O)NC(=O)C(C)NC(=O)C(C(C)O)NC(=O)CC(=O)C(C)CC(C)CC(C)C(C(C)C(C(C)O)OC3C(C(C(C(O3)CO)OC)O)O)O)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)NCC(=O)N[C@@H]([C@H](C(=O)N[C@@H](C(=O)N1)C2=CC(=C(C(=C2Cl)O)C)OS(=O)(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H]([C@@H](C)O)NC(=O)CC(=O)C(C)CC(C)CC(C)C(C(C)C(C(C)O)OC3[C@@H]([C@H]([C@@H]([C@H](O3)CO)OC)O)O)O)C |
| InChI | InChI=1S/C52H84ClN7O22S/c1-13-21(3)37-48(72)54-18-35(66)55-26(8)38(49(73)60-40(51(75)58-37)30-16-32(82-83(76,77)78)24(6)42(68)36(30)53)59-47(71)27(9)56-50(74)39(28(10)62)57-34(65)17-31(64)22(4)14-20(2)15-23(5)41(67)25(7)45(29(11)63)81-52-44(70)43(69)46(79-12)33(19-61)80-52/h16,20-23,25-29,33,37-41,43-46,52,61-63,67-70H,13-15,17-19H2,1-12H3,(H,54,72)(H,55,66)(H,56,74)(H,57,65)(H,58,75)(H,59,71)(H,60,73)(H,76,77,78)/t20?,21-,22?,23?,25?,26+,27-,28+,29?,33+,37-,38+,39+,40+,41?,43+,44+,45?,46+,52?/m0/s1 |
| InChI Key | SLDMXMFVHHHMOO-WMEDMEPBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C52H84ClN7O22S |
| Molecular Weight | 1226.80 g/mol |
| Exact Mass | 1225.5078662 g/mol |
| Topological Polar Surface Area (TPSA) | 462.00 Ų |
| XlogP | -0.50 |
| Atomic LogP (AlogP) | -2.42 |
| H-Bond Acceptor | 21 |
| H-Bond Donor | 15 |
| Rotatable Bonds | 26 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7917 | 79.17% |
| Caco-2 | - | 0.8586 | 85.86% |
| Blood Brain Barrier | - | 0.7750 | 77.50% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Lysosomes | 0.3840 | 38.40% |
| OATP2B1 inhibitior | - | 0.8640 | 86.40% |
| OATP1B1 inhibitior | + | 0.8022 | 80.22% |
| OATP1B3 inhibitior | + | 0.9322 | 93.22% |
| MATE1 inhibitior | - | 0.8600 | 86.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.8749 | 87.49% |
| P-glycoprotein inhibitior | + | 0.7409 | 74.09% |
| P-glycoprotein substrate | + | 0.8527 | 85.27% |
| CYP3A4 substrate | + | 0.7490 | 74.90% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8632 | 86.32% |
| CYP3A4 inhibition | + | 0.5897 | 58.97% |
| CYP2C9 inhibition | - | 0.6821 | 68.21% |
| CYP2C19 inhibition | - | 0.6386 | 63.86% |
| CYP2D6 inhibition | - | 0.8296 | 82.96% |
| CYP1A2 inhibition | - | 0.7099 | 70.99% |
| CYP2C8 inhibition | + | 0.8324 | 83.24% |
| CYP inhibitory promiscuity | - | 0.5947 | 59.47% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | + | 0.5200 | 52.00% |
| Carcinogenicity (trinary) | Non-required | 0.5736 | 57.36% |
| Eye corrosion | - | 0.9767 | 97.67% |
| Eye irritation | - | 0.8964 | 89.64% |
| Skin irritation | - | 0.7604 | 76.04% |
| Skin corrosion | - | 0.9129 | 91.29% |
| Ames mutagenesis | - | 0.5800 | 58.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7241 | 72.41% |
| Micronuclear | + | 0.8900 | 89.00% |
| Hepatotoxicity | + | 0.5875 | 58.75% |
| skin sensitisation | - | 0.8285 | 82.85% |
| Respiratory toxicity | + | 0.7000 | 70.00% |
| Reproductive toxicity | + | 0.8111 | 81.11% |
| Mitochondrial toxicity | + | 0.7750 | 77.50% |
| Nephrotoxicity | - | 0.8454 | 84.54% |
| Acute Oral Toxicity (c) | III | 0.5817 | 58.17% |
| Estrogen receptor binding | + | 0.7245 | 72.45% |
| Androgen receptor binding | + | 0.7466 | 74.66% |
| Thyroid receptor binding | + | 0.6279 | 62.79% |
| Glucocorticoid receptor binding | + | 0.7193 | 71.93% |
| Aromatase binding | + | 0.6921 | 69.21% |
| PPAR gamma | + | 0.7959 | 79.59% |
| Honey bee toxicity | - | 0.6326 | 63.26% |
| Biodegradation | - | 0.7750 | 77.50% |
| Crustacea aquatic toxicity | - | 0.6900 | 69.00% |
| Fish aquatic toxicity | + | 0.9649 | 96.49% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.47% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.26% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.63% | 91.11% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 97.04% | 98.05% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.18% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.53% | 94.73% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 93.14% | 98.59% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.56% | 93.10% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 92.52% | 96.90% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 92.43% | 97.88% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.99% | 96.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 91.36% | 96.38% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 90.96% | 91.03% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 90.53% | 96.69% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 90.22% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.20% | 94.00% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 90.10% | 99.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.97% | 95.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.31% | 97.14% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.99% | 89.34% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.57% | 94.66% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.44% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.08% | 89.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.36% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.28% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.10% | 98.75% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.92% | 94.33% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.74% | 89.50% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 84.57% | 97.50% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.46% | 95.52% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.09% | 96.21% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 84.03% | 94.45% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.56% | 92.50% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 83.24% | 91.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.62% | 93.56% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 81.44% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.35% | 97.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.30% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.20% | 95.89% |
| CHEMBL2104 | Q99571 | P2X purinoceptor 4 | 80.99% | 97.50% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.81% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684512 |
| LOTUS | LTS0029232 |
| wikiData | Q105255222 |