Tosylphenylalanyl chloromethyl ketone
| Internal ID | f24258ff-3d15-4dfc-859a-194c4cf5f80c |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Toluenes > Tosyl compounds > P-toluenesulfonamides |
| IUPAC Name | N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| SMILES (Canonical) | CC1=CC=C(C=C1)S(=O)(=O)NC(CC2=CC=CC=C2)C(=O)CCl |
| SMILES (Isomeric) | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](CC2=CC=CC=C2)C(=O)CCl |
| InChI | InChI=1S/C17H18ClNO3S/c1-13-7-9-15(10-8-13)23(21,22)19-16(17(20)12-18)11-14-5-3-2-4-6-14/h2-10,16,19H,11-12H2,1H3/t16-/m0/s1 |
| InChI Key | MQUQNUAYKLCRME-INIZCTEOSA-N |
| Popularity | 537 references in papers |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.0695923 g/mol |
| Topological Polar Surface Area (TPSA) | 71.60 Ų |
| XlogP | 3.60 |
| Atomic LogP (AlogP) | 2.69 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 7 |
| TOSYLPHENYLALANYL CHLOROMETHYL KETONE |
| N-Tosyl-L-phenylalanyl chloromethyl ketone |
| N-Tosyl-L-phenylalanine chloromethyl ketone |
| L-1-Tosylamido-2-phenylethyl chloromethyl ketone |
| l-N-(alpha-(Chloroacetyl)phenethyl)-p-toluenesulfonamide |
| CHEBI:9642 |
| DTXSID60883376 |
| N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]-4-methylbenzenesulfonamide |
| P598716LJT |
| NSC-727365 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9948 | 99.48% |
| Caco-2 | - | 0.5837 | 58.37% |
| Blood Brain Barrier | + | 0.8000 | 80.00% |
| Human oral bioavailability | + | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.5935 | 59.35% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.9360 | 93.60% |
| OATP1B3 inhibitior | + | 0.9439 | 94.39% |
| MATE1 inhibitior | - | 0.9600 | 96.00% |
| OCT2 inhibitior | - | 0.7250 | 72.50% |
| BSEP inhibitior | + | 0.8483 | 84.83% |
| P-glycoprotein inhibitior | - | 0.8813 | 88.13% |
| P-glycoprotein substrate | - | 0.7876 | 78.76% |
| CYP3A4 substrate | - | 0.5660 | 56.60% |
| CYP2C9 substrate | - | 0.7747 | 77.47% |
| CYP2D6 substrate | - | 0.7889 | 78.89% |
| CYP3A4 inhibition | + | 0.7959 | 79.59% |
| CYP2C9 inhibition | + | 0.8949 | 89.49% |
| CYP2C19 inhibition | + | 0.8994 | 89.94% |
| CYP2D6 inhibition | - | 0.9230 | 92.30% |
| CYP1A2 inhibition | + | 0.9107 | 91.07% |
| CYP2C8 inhibition | - | 0.8563 | 85.63% |
| CYP inhibitory promiscuity | + | 0.8727 | 87.27% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.5096 | 50.96% |
| Carcinogenicity (trinary) | Non-required | 0.6302 | 63.02% |
| Eye corrosion | - | 0.9634 | 96.34% |
| Eye irritation | - | 0.8897 | 88.97% |
| Skin irritation | - | 0.7756 | 77.56% |
| Skin corrosion | - | 0.9129 | 91.29% |
| Ames mutagenesis | - | 0.5270 | 52.70% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.8361 | 83.61% |
| Micronuclear | + | 0.9100 | 91.00% |
| Hepatotoxicity | + | 0.6250 | 62.50% |
| skin sensitisation | - | 0.8610 | 86.10% |
| Respiratory toxicity | + | 0.5778 | 57.78% |
| Reproductive toxicity | - | 0.6111 | 61.11% |
| Mitochondrial toxicity | + | 0.5500 | 55.00% |
| Nephrotoxicity | + | 0.5680 | 56.80% |
| Acute Oral Toxicity (c) | III | 0.6822 | 68.22% |
| Estrogen receptor binding | + | 0.6068 | 60.68% |
| Androgen receptor binding | - | 0.5329 | 53.29% |
| Thyroid receptor binding | - | 0.7956 | 79.56% |
| Glucocorticoid receptor binding | - | 0.7987 | 79.87% |
| Aromatase binding | - | 0.5776 | 57.76% |
| PPAR gamma | - | 0.7071 | 70.71% |
| Honey bee toxicity | - | 0.9356 | 93.56% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
| Fish aquatic toxicity | + | 0.9817 | 98.17% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
17782.8 nM 19952.6 nM |
Potency Potency |
via CMAUP
PMID: 19459694 |
| CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
794.3 nM 398.1 nM 1000 nM 398.1 nM |
Potency Potency Potency Potency |
PMID: 2362284
via Super-PRED PMID: 22182501 PMID: 19874044 |
| CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
6309.6 nM 3162.3 nM |
Potency Potency |
PMID: 22694318
PMID: 12502321 |
| CHEMBL4068 | P23946 | Chymase |
3300 nM |
IC50 |
PMID: 25871261
|
| CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
12589.25 nM |
AC50 |
PMID: 18332176
|
| CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
10000 nM |
Potency |
via CMAUP
|
| CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
19952.6 nM |
Potency |
PMID: 9733489
|
| CHEMBL340 | P08684 | Cytochrome P450 3A4 |
3162.3 nM 3162.3 nM |
Potency Potency |
PMID: 21925888
via CMAUP |
| CHEMBL1293278 | O75496 | Geminin |
3162.3 nM |
Potency |
PMID: 15620251
|
| CHEMBL5514 | P42858 | Huntingtin |
35481.3 nM |
Potency |
PMID: 22260257
|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
25118.9 nM 25118.9 nM |
Potency Potency |
PMID: 11543673
via CMAUP |
| CHEMBL4040 | P28482 | MAP kinase ERK2 |
19952.6 nM |
Potency |
via CMAUP
|
| CHEMBL1293224 | P10636 | Microtubule-associated protein tau |
8912.5 nM 112.2 nM 7079.5 nM |
Potency Potency Potency |
PMID: 1602298
PMID: 21090801 PMID: 24694263 |
| CHEMBL5162 | Q6W5P4 | Neuropeptide S receptor |
12589.3 nM 19952.6 nM |
Potency Potency |
PMID: 19105653
PMID: 18183025 |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
3162.3 nM 3162.3 nM |
Potency Potency |
DOI: 10.1007/s00044-009-9206-8
PMID: 22548480 |
| CHEMBL1293298 | Q01453 | Peripheral myelin protein 22 |
30131.3 nM |
Potency |
PMID: 19064900
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
7079.5 nM 2818.4 nM 14125.4 nM |
Potency Potency Potency |
PMID: 14698171
PMID: 23305465 PMID: 23891163 |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR |
23280.9 nM 20749.1 nM 18492.7 nM 16481.6 nM |
Potency Potency Potency Potency |
PMID: 2578192
PMID: 22070654 PMID: 11931609 PMID: 18417256 |
| CHEMBL1293232 | Q16637 | Survival motor neuron protein |
28183.8 nM 17782.8 nM 1000 nM |
Potency Potency Potency |
via CMAUP
DOI: 10.6019/CHEMBL1201861 PMID: 25938459 |
| CHEMBL1293256 | P40225 | Thrombopoietin |
10000 nM 10000 nM |
Potency Potency |
via CMAUP
via CMAUP |
| CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
31622.8 nM |
Potency |
PMID: 26355532
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.48% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.76% | 95.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.85% | 90.17% |
| CHEMBL1741221 | Q9Y4P1 | Cysteine protease ATG4B | 94.18% | 87.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.32% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.72% | 96.09% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.49% | 93.81% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.42% | 93.56% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.00% | 93.03% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.67% | 96.90% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.06% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.74% | 96.00% |
| CHEMBL5932 | P53671 | LIM domain kinase 2 | 80.69% | 96.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cyanthillium cinereum |
| PubChem | 439647 |
| NPASS | NPC476440 |
| ChEMBL | CHEMBL60718 |
| LOTUS | LTS0006770 |
| wikiData | Q7827912 |