Torvoside E
Internal ID | 5a86d6d5-645b-4c56-a08e-c8101cae8ab1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,6R,7S,8R,9S,12S,13R,18S,19S)-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-one |
SMILES (Canonical) | CC1C2C(CC3C2(CCC4C3CC(C5C4(CCC(=O)C5)C)OC6C(C(C(C(O6)C)O)O)O)C)OC1(CCC(C)COC7C(C(C(C(O7)CO)O)O)O)OC |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(CC[C@H]4[C@H]3C[C@@H]([C@@H]5[C@@]4(CCC(=O)C5)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C)O)O)O)C)O[C@@]1(CC[C@H](C)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)OC |
InChI | InChI=1S/C40H66O14/c1-18(17-50-36-34(47)33(46)31(44)28(16-41)53-36)7-12-40(49-6)19(2)29-27(54-40)15-24-22-14-26(52-37-35(48)32(45)30(43)20(3)51-37)25-13-21(42)8-10-38(25,4)23(22)9-11-39(24,29)5/h18-20,22-37,41,43-48H,7-17H2,1-6H3/t18-,19-,20+,22+,23-,24-,25+,26-,27-,28+,29-,30+,31+,32-,33-,34+,35+,36+,37-,38+,39-,40+/m0/s1 |
InChI Key | SPXXSSPWDGTYTM-MSZUGDPKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H66O14 |
Molecular Weight | 770.90 g/mol |
Exact Mass | 770.44525677 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 1.60 |
CHEBI:191976 |
(1R,2S,4S,6R,7S,8R,9S,12S,13R,18S,19S)-6-methoxy-7,9,13-trimethyl-6-[(3S)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.42% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.80% | 98.95% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.54% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.08% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.48% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 89.02% | 96.61% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.88% | 96.43% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.42% | 92.86% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.27% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.86% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.58% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.20% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.02% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.81% | 92.98% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.20% | 97.33% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.95% | 98.10% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.57% | 90.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.23% | 94.73% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.60% | 92.88% |
CHEMBL3820 | P35557 | Hexokinase type IV | 81.14% | 91.96% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.67% | 97.25% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 80.66% | 92.78% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.63% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum torvum |
PubChem | 102444968 |
LOTUS | LTS0166195 |
wikiData | Q105257672 |