Tortuosamine
| Internal ID | 08c3354d-c046-402f-954c-8247827bfad5 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Phenylquinolines |
| IUPAC Name | 2-[(6R)-6-(3,4-dimethoxyphenyl)-7,8-dihydro-5H-quinolin-6-yl]-N-methylethanamine |
| SMILES (Canonical) | CNCCC1(CCC2=C(C1)C=CC=N2)C3=CC(=C(C=C3)OC)OC |
| SMILES (Isomeric) | CNCC[C@]1(CCC2=C(C1)C=CC=N2)C3=CC(=C(C=C3)OC)OC |
| InChI | InChI=1S/C20H26N2O2/c1-21-12-10-20(9-8-17-15(14-20)5-4-11-22-17)16-6-7-18(23-2)19(13-16)24-3/h4-7,11,13,21H,8-10,12,14H2,1-3H3/t20-/m0/s1 |
| InChI Key | QFRVOGLOHJOHAY-FQEVSTJZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.199428076 g/mol |
| Topological Polar Surface Area (TPSA) | 43.40 Ų |
| XlogP | 3.20 |
| (-)-Tortuosamine |
| G4T9Z3RXX9 |
| Tortuosamine |
| UNII-G4T9Z3RXX9 |
| 35722-04-4 |
| (6R)-6-(3,4-Dimethoxyphenyl)-5,6,7,8-tetrahydro-N-methyl-6-quinolineethanamine |
| 6-Quinolineethanamine, 6-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-N-methyl-, (6R)- |
| 6-Quinolineethanamine, 6-(3,4-dimethoxyphenyl)-5,6,7,8-tetrahydro-N-methyl-, (R)- |
| DTXSID201045657 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.92% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 94.40% | 95.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.40% | 85.14% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 92.14% | 97.53% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.88% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.33% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.05% | 86.33% |
| CHEMBL4699 | O60725 | Isoprenylcysteine carboxyl methyltransferase | 90.85% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.59% | 98.75% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 89.34% | 92.97% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 88.62% | 94.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.08% | 98.95% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.99% | 90.00% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.43% | 92.98% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 86.22% | 85.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.45% | 94.45% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.92% | 95.12% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.58% | 91.07% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.52% | 96.00% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 83.40% | 96.06% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.29% | 96.00% |
| CHEMBL288 | Q08499 | Phosphodiesterase 4D | 81.70% | 97.50% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 81.44% | 91.79% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.41% | 96.67% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 80.82% | 94.67% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.34% | 92.62% |
| CHEMBL3891 | P07384 | Calpain 1 | 80.15% | 93.04% |
| CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.03% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Mesembryanthemum ladismithiense |
| Mesembryanthemum tortuosum |
| PubChem | 101324747 |
| LOTUS | LTS0059117 |
| wikiData | Q105219727 |