Torreferol
| Internal ID | f4407707-9ae9-49d9-b92d-0338fd08c810 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | (3S)-5-[(4aR,5R,8aR)-5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-1-en-3-ol |
| SMILES (Canonical) | CC1(CCCC2(C1CCC(=C)C2CCC(C)(C=C)O)C)CO |
| SMILES (Isomeric) | C[C@]1(CCC[C@]2([C@H]1CCC(=C)C2CC[C@@](C)(C=C)O)C)CO |
| InChI | InChI=1S/C20H34O2/c1-6-19(4,22)13-10-16-15(2)8-9-17-18(3,14-21)11-7-12-20(16,17)5/h6,16-17,21-22H,1-2,7-14H2,3-5H3/t16?,17-,18-,19+,20+/m0/s1 |
| InChI Key | IERFAZQCIAZODG-SPACUTFJSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.255880323 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 4.30 |
| CHEMBL596905 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.12% | 97.25% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 97.55% | 99.43% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.57% | 91.11% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 91.41% | 90.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.01% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.66% | 97.79% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.29% | 95.89% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.42% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.86% | 98.95% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.17% | 95.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.15% | 95.38% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.17% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 83.34% | 97.93% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.29% | 97.05% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.92% | 98.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.14% | 86.33% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 80.13% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Abies chensiensis |
| Abies forrestii var. georgei |
| PubChem | 46230470 |
| LOTUS | LTS0160557 |
| wikiData | Q104400768 |