Torquatone
| Internal ID | 1449ee1d-01d7-45e9-a957-9673520b26b9 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | 3-methyl-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)butan-1-one |
| SMILES (Canonical) | CC1=C(C(=C(C(=C1OC)C(=O)CC(C)C)OC)C)OC |
| SMILES (Isomeric) | CC1=C(C(=C(C(=C1OC)C(=O)CC(C)C)OC)C)OC |
| InChI | InChI=1S/C16H24O4/c1-9(2)8-12(17)13-15(19-6)10(3)14(18-5)11(4)16(13)20-7/h9H,8H2,1-7H3 |
| InChI Key | PYUCCSKQLHUKCA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 44.80 Ų |
| XlogP | 3.50 |
| 3567-96-2 |
| 3-methyl-1-(2,4,6-trimethoxy-3,5-dimethylphenyl)butan-1-one |
| NSC83432 |
| NCIOpen2_004597 |
| CHEMBL1972146 |
| SCHEMBL11422414 |
| DTXSID80292527 |
| PYUCCSKQLHUKCA-UHFFFAOYSA-N |
| NSC-83432 |
| NCI60_041838 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.59% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.89% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.26% | 97.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.68% | 93.56% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.03% | 96.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.76% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.07% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.62% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eucalyptus apodophylla |
| Eucalyptus caesia |
| Eucalyptus dolichorhyncha |
| Eucalyptus leucoxylon |
| Eucalyptus spathulata |
| Eucalyptus torquata |
| PubChem | 256516 |
| LOTUS | LTS0104580 |
| wikiData | Q67880116 |