Tjipanazole I
| Internal ID | 58e331bb-dc8c-4ce0-b626-d74624e30f14 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles > Pyrrolocarbazoles > Indolocarbazoles |
| IUPAC Name | 3-chloro-11,12-dihydroindolo[2,3-a]carbazole |
| SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C5=C(N4)C=CC(=C5)Cl |
| SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C5=C(N4)C=CC(=C5)Cl |
| InChI | InChI=1S/C18H11ClN2/c19-10-5-8-16-14(9-10)13-7-6-12-11-3-1-2-4-15(11)20-17(12)18(13)21-16/h1-9,20-21H |
| InChI Key | FTMOEUBKRZXYEX-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.0610761 g/mol |
| Topological Polar Surface Area (TPSA) | 31.60 Ų |
| XlogP | 5.50 |
| SCHEMBL16432834 |
| DTXSID601333985 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.65% | 91.11% |
| CHEMBL240 | Q12809 | HERG | 97.53% | 89.76% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.10% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.38% | 95.56% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.35% | 91.71% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.17% | 86.92% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 88.64% | 94.62% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 87.96% | 90.71% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 86.35% | 96.00% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 85.42% | 85.94% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 84.51% | 96.42% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.82% | 93.81% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 83.29% | 93.24% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 81.99% | 97.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.76% | 98.59% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 81.28% | 95.56% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 81.12% | 90.65% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 80.32% | 93.53% |
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 80.27% | 94.23% |
| CHEMBL2708 | Q16584 | Mitogen-activated protein kinase kinase kinase 11 | 80.18% | 81.14% |
| CHEMBL2104 | Q99571 | P2X purinoceptor 4 | 80.18% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10755969 |
| LOTUS | LTS0214672 |
| wikiData | Q104203093 |