Thielavin T
| Internal ID | 08f3a840-4b53-4ada-9a15-d0d6789627fb |
| Taxonomy | Phenylpropanoids and polyketides > Depsides and depsidones |
| IUPAC Name | (3-hydroxy-2,5-dimethylphenyl) 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate |
| SMILES (Canonical) | CC1=CC(=C(C(=C1)OC(=O)C2=C(C(=C(C(=C2C)C)OC(=O)C3=C(C=C(C=C3C)O)O)C)O)C)O |
| SMILES (Isomeric) | CC1=CC(=C(C(=C1)OC(=O)C2=C(C(=C(C(=C2C)C)OC(=O)C3=C(C=C(C=C3C)O)O)C)O)C)O |
| InChI | InChI=1S/C26H26O8/c1-11-7-18(28)15(5)20(8-11)33-26(32)22-13(3)14(4)24(16(6)23(22)30)34-25(31)21-12(2)9-17(27)10-19(21)29/h7-10,27-30H,1-6H3 |
| InChI Key | VYBBSNNAJCXPRE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C26H26O8 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.16276778 g/mol |
| Topological Polar Surface Area (TPSA) | 134.00 Ų |
| XlogP | 6.60 |
| (3-hydroxy-2,5-dimethylphenyl) 4-(2,4-dihydroxy-6-methylbenzoyl)oxy-2-hydroxy-3,5,6-trimethylbenzoate |
| RefChem:189354 |
| 3-Hydroxy-2,5-dimethylphenyl 4-(2,4-dihydroxy-6-methylbenzoyloxy)-2-hydroxy-3,5,6-trimethylbenzoic acid |
| SCHEMBL30545882 |
| CHEBI:222213 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.46% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 90.34% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.70% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.67% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.70% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.97% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.37% | 99.17% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.06% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.68% | 94.73% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.61% | 94.42% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.98% | 95.50% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.62% | 94.45% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.95% | 96.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.67% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.29% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139586436 |
| LOTUS | LTS0120478 |
| wikiData | Q77506474 |