Terrusnolide D
| Internal ID | 2de11570-1e94-45e4-885d-27df8af3f989 |
| Taxonomy | Organoheterocyclic compounds > Coumarans |
| IUPAC Name | (2R)-4-(4-hydroxyphenyl)-3-[[2-(2-hydroxypropan-2-yl)-2,3-dihydro-1-benzofuran-5-yl]methyl]-2-methoxy-2H-furan-5-one |
| SMILES (Canonical) | CC(C)(C1CC2=C(O1)C=CC(=C2)CC3=C(C(=O)OC3OC)C4=CC=C(C=C4)O)O |
| SMILES (Isomeric) | CC(C)(C1CC2=C(O1)C=CC(=C2)CC3=C(C(=O)O[C@H]3OC)C4=CC=C(C=C4)O)O |
| InChI | InChI=1S/C23H24O6/c1-23(2,26)19-12-15-10-13(4-9-18(15)28-19)11-17-20(21(25)29-22(17)27-3)14-5-7-16(24)8-6-14/h4-10,19,22,24,26H,11-12H2,1-3H3/t19?,22-/m1/s1 |
| InChI Key | QGWNXSMDRPLOFM-AVKWCDSFSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15728848 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.76% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.80% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.65% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.13% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.65% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.68% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.01% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.64% | 94.73% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.62% | 95.89% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.10% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.33% | 95.89% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 88.69% | 95.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.18% | 99.17% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.66% | 93.99% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 87.48% | 95.53% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.15% | 96.95% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 85.65% | 97.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.46% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.40% | 97.09% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 84.10% | 98.35% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.36% | 95.71% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 81.66% | 90.93% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.28% | 95.50% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.17% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684410 |
| LOTUS | LTS0080526 |
| wikiData | Q105220744 |