Terricollene A
| Internal ID | 64ced5e2-8cc1-4be3-b77b-82ebefc69ff6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
| IUPAC Name | |
| SMILES (Canonical) | C=C=CCOC1=CC=C(C=C1)COC2C(C(C(C(O2)CO)O)O)O |
| SMILES (Isomeric) | C=C=CCOC1=CC=C(C=C1)CO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| InChI | InChI=1S/C17H22O7/c1-2-3-8-22-12-6-4-11(5-7-12)10-23-17-16(21)15(20)14(19)13(9-18)24-17/h3-7,13-21H,1,8-10H2/t13-,14-,15+,16-,17-/m1/s1 |
| InChI Key | PLHYONMLZLAVMD-NQNKBUKLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.13655304 g/mol |
| Topological Polar Surface Area (TPSA) | 109.00 Ų |
| XlogP | -0.50 |
| CHEMBL1078078 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.23% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.56% | 99.17% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 93.28% | 83.57% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.81% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.52% | 96.09% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 88.95% | 97.53% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.40% | 90.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.86% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.58% | 94.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.05% | 86.92% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.52% | 95.89% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 84.32% | 94.97% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.17% | 89.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.91% | 86.33% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 81.72% | 95.83% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.47% | 97.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 81.32% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.27% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46882749 |
| LOTUS | LTS0073241 |
| wikiData | Q105210936 |