Terrestrol D
| Internal ID | 0af56f06-3a80-4c6c-9266-c3be70dfea00 |
| Taxonomy | Benzenoids > Phenols > 4-alkoxyphenols |
| IUPAC Name | 2-[[3-chloro-4-hydroxy-5-(hydroxymethyl)phenoxy]methyl]benzene-1,4-diol |
| SMILES (Canonical) | C1=CC(=C(C=C1O)COC2=CC(=C(C(=C2)Cl)O)CO)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1O)COC2=CC(=C(C(=C2)Cl)O)CO)O |
| InChI | InChI=1S/C14H13ClO5/c15-12-5-11(4-8(6-16)14(12)19)20-7-9-3-10(17)1-2-13(9)18/h1-5,16-19H,6-7H2 |
| InChI Key | WTDORBLYOHYLPZ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H13ClO5 |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.0451512 g/mol |
| Topological Polar Surface Area (TPSA) | 90.20 Ų |
| XlogP | 2.60 |
| CHEMBL402538 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.30% | 91.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 97.92% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.55% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.94% | 94.73% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.54% | 91.71% |
| CHEMBL3194 | P02766 | Transthyretin | 90.29% | 90.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.70% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.87% | 94.45% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 86.34% | 98.35% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.20% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.94% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.74% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.82% | 95.56% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 81.18% | 93.81% |
| CHEMBL2104 | Q99571 | P2X purinoceptor 4 | 80.16% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 24770504 |
| LOTUS | LTS0162254 |
| wikiData | Q77505894 |