Terpeptin
| Internal ID | 53a34be6-84ba-4a45-a9c4-7336d1e5e5cb |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-acetamido-N,3-dimethyl-N-[(2S)-3-methyl-1-[[(Z)-2-[2-(3-methylbut-2-enyl)-1H-indol-3-yl]ethenyl]amino]-1-oxobutan-2-yl]butanamide |
| SMILES (Canonical) | CC(C)C(C(=O)N(C)C(C(C)C)C(=O)NC=CC1=C(NC2=CC=CC=C21)CC=C(C)C)NC(=O)C |
| SMILES (Isomeric) | CC(C)[C@@H](C(=O)N(C)[C@@H](C(C)C)C(=O)N/C=C\C1=C(NC2=CC=CC=C21)CC=C(C)C)NC(=O)C |
| InChI | InChI=1S/C28H40N4O3/c1-17(2)13-14-24-22(21-11-9-10-12-23(21)31-24)15-16-29-27(34)26(19(5)6)32(8)28(35)25(18(3)4)30-20(7)33/h9-13,15-16,18-19,25-26,31H,14H2,1-8H3,(H,29,34)(H,30,33)/b16-15-/t25-,26-/m0/s1 |
| InChI Key | QKRDCXNLINQVQN-QXYKFECQSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.31004115 g/mol |
| Topological Polar Surface Area (TPSA) | 94.30 Ų |
| XlogP | 5.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.11% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.30% | 85.14% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 93.22% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.19% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.15% | 95.56% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.60% | 98.59% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.78% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.65% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.38% | 96.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.31% | 88.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.91% | 90.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.51% | 96.00% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.85% | 96.61% |
| CHEMBL5028 | O14672 | ADAM10 | 86.95% | 97.50% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 85.56% | 97.50% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 84.80% | 95.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 82.44% | 87.45% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.55% | 93.56% |
| CHEMBL3308 | P55212 | Caspase-6 | 81.32% | 97.56% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 81.31% | 92.97% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.67% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9913062 |
| LOTUS | LTS0103365 |
| wikiData | Q105223281 |