Termicalcicolanone B
| Internal ID | 4efbe103-3137-4af5-8588-cbc3f26c3181 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 8-prenylated xanthones |
| IUPAC Name | 9,10-dihydroxy-3,3-dimethyl-8-(3-methylbut-2-enyl)pyrano[2,3-c]xanthen-7-one |
| SMILES (Canonical) | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(O2)C4=C(C=C3)OC(C=C4)(C)C)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(O2)C4=C(C=C3)OC(C=C4)(C)C)O)O)C |
| InChI | InChI=1S/C23H22O5/c1-12(2)5-6-14-19-18(11-16(24)20(14)25)27-22-13-9-10-23(3,4)28-17(13)8-7-15(22)21(19)26/h5,7-11,24-25H,6H2,1-4H3 |
| InChI Key | VCWSESMETSMYLY-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14672380 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 5.10 |
| CHEMBL225619 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.09% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.45% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.01% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.13% | 94.73% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 92.60% | 91.38% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.18% | 91.49% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 90.59% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.38% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.44% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.01% | 94.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.64% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.40% | 86.33% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.99% | 95.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.53% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Terminalia calcicola |
| PubChem | 44421645 |
| LOTUS | LTS0248852 |
| wikiData | Q105284006 |