Tensyuic acid E
| Internal ID | 46711c9f-ff49-4594-8f9c-acecced68bc0 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | 2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid |
| SMILES (Canonical) | COC(=O)CCCCCCCC(C(=C)C(=O)O)C(=O)O |
| SMILES (Isomeric) | COC(=O)CCCCCCCC(C(=C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22O6/c1-10(13(16)17)11(14(18)19)8-6-4-3-5-7-9-12(15)20-2/h11H,1,3-9H2,2H3,(H,16,17)(H,18,19) |
| InChI Key | IOUNJEVHPQCKKE-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14163842 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 2.60 |
| (+)-tensyuic acid E |
| CHEBI:133831 |
| (+)-2-(8-methoxy-8-oxooctyl)-3-methylenesuccinic acid |
| 2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid |
| (3Xi)-2-(8-methoxy-8-oxooctyl)-3-methylenesuccinic acid |
| (+)-2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid |
| (3Xi)-2-(8-methoxy-8-oxooctyl)-3-methylidenebutanedioic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.91% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.42% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.12% | 99.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 92.38% | 95.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.25% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.82% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.35% | 97.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.38% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.10% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.02% | 94.45% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.02% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.26% | 96.00% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.19% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23652018 |
| LOTUS | LTS0131384 |
| wikiData | Q77493852 |