Tenllone I
| Internal ID | 1bdbf77c-a89c-4bd5-ae10-59e88659772e |
| Taxonomy | Organoheterocyclic compounds > Benzoxepines > Dibenzoxepines |
| IUPAC Name | (2R)-9-hydroxy-2-(2-hydroxypropan-2-yl)-6-methyl-12-(3-methylbut-2-enyl)-3,8-dihydro-2H-[1,4]benzodioxino[7,8-c][2]benzoxepin-13-one |
| SMILES (Canonical) | CC1=CC2=C(C3=C1OCC4=C(C=CC(=C4C3=O)CC=C(C)C)O)OC(CO2)C(C)(C)O |
| SMILES (Isomeric) | CC1=CC2=C(C3=C1OCC4=C(C=CC(=C4C3=O)CC=C(C)C)O)O[C@H](CO2)C(C)(C)O |
| InChI | InChI=1S/C25H28O6/c1-13(2)6-7-15-8-9-17(26)16-11-30-23-14(3)10-18-24(21(23)22(27)20(15)16)31-19(12-29-18)25(4,5)28/h6,8-10,19,26,28H,7,11-12H2,1-5H3/t19-/m1/s1 |
| InChI Key | REUMTLWYRYSHJD-LJQANCHMSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 85.20 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.44% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.97% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.97% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.80% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.37% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.96% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.18% | 89.00% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.32% | 93.40% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.77% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.96% | 96.95% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.79% | 90.93% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.83% | 99.23% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 84.90% | 97.21% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.59% | 97.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.71% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.16% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.96% | 95.89% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 81.42% | 81.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.80% | 96.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.78% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683441 |
| LOTUS | LTS0218527 |
| wikiData | Q105235112 |