Tenellone F
| Internal ID | 135be1f0-4ece-4353-b255-f009461ba28c |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
| IUPAC Name | 6-hydroxy-2-[2-hydroxy-5-methyl-3-(3-methyl-2-oxobutoxy)benzoyl]-3-(3-methylbut-2-enyl)benzaldehyde |
| SMILES (Canonical) | CC1=CC(=C(C(=C1)OCC(=O)C(C)C)O)C(=O)C2=C(C=CC(=C2C=O)O)CC=C(C)C |
| SMILES (Isomeric) | CC1=CC(=C(C(=C1)OCC(=O)C(C)C)O)C(=O)C2=C(C=CC(=C2C=O)O)CC=C(C)C |
| InChI | InChI=1S/C25H28O6/c1-14(2)6-7-17-8-9-20(27)19(12-26)23(17)25(30)18-10-16(5)11-22(24(18)29)31-13-21(28)15(3)4/h6,8-12,15,27,29H,7,13H2,1-5H3 |
| InChI Key | BQNHNSQWEYHRLI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18858861 g/mol |
| Topological Polar Surface Area (TPSA) | 101.00 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 96.75% | 98.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.06% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.90% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.22% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.59% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.14% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.17% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.50% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.93% | 94.45% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 89.37% | 90.24% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.94% | 95.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 87.62% | 90.00% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.63% | 90.71% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.25% | 99.17% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.07% | 98.75% |
| CHEMBL3194 | P02766 | Transthyretin | 83.62% | 90.71% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.93% | 94.80% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.72% | 89.00% |
| CHEMBL3979 | Q03181 | Peroxisome proliferator-activated receptor delta | 81.63% | 93.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.30% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 81.14% | 89.62% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.99% | 96.90% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.20% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139590732 |
| LOTUS | LTS0133211 |
| wikiData | Q103816934 |