Telosmoside A3
| Internal ID | 724fb195-a33f-460e-843d-83e405e50836 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
| IUPAC Name | [(1S)-1-[(3S,5S,8R,9S,10S,12R,13S,14S,17S)-12-acetyloxy-3-[(2S,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,3R,4R,5R,6R)-5-[(2S,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-3-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-14,17-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] (2S)-2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC(C)C1(CCC2(C1(C(CC3C2CCC4C3(CCC(C4)OC5CC(C(C(O5)C)OC6CC(C(C(O6)C)OC7C(C(C(C(O7)C)OC8C(C(C(C(O8)CO)OC9C(C(C(C(O9)CO)O)O)O)O)O)OC)O)OC)OC)C)OC(=O)C)C)O)O |
| SMILES (Isomeric) | CC[C@H](C)C(=O)O[C@@H](C)[C@@]1(CC[C@]2([C@@]1([C@@H](C[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)O[C@@H]5C[C@@H]([C@@H]([C@H](O5)C)O[C@H]6C[C@@H]([C@@H]([C@H](O6)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)OC)O)OC)OC)C)OC(=O)C)C)O)O |
| InChI | InChI=1S/C61H102O27/c1-13-26(2)54(71)80-30(6)60(72)18-19-61(73)34-15-14-32-20-33(16-17-58(32,8)35(34)21-40(59(60,61)9)81-31(7)64)82-41-22-36(74-10)49(27(3)77-41)85-42-23-37(75-11)50(28(4)78-42)86-57-48(70)53(76-12)51(29(5)79-57)87-56-47(69)45(67)52(39(25-63)84-56)88-55-46(68)44(66)43(65)38(24-62)83-55/h26-30,32-53,55-57,62-63,65-70,72-73H,13-25H2,1-12H3/t26-,27+,28+,29+,30-,32-,33-,34+,35-,36-,37-,38+,39+,40+,41+,42-,43+,44-,45+,46+,47+,48+,49+,50+,51+,52+,53+,55-,56-,57-,58-,59+,60+,61-/m0/s1 |
| InChI Key | XJGCRJAXHOCFSW-KDDDPLSHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C61H102O27 |
| Molecular Weight | 1267.40 g/mol |
| Exact Mass | 1266.66084797 g/mol |
| Topological Polar Surface Area (TPSA) | 375.00 Ų |
| XlogP | 0.40 |
| Atomic LogP (AlogP) | -0.02 |
| H-Bond Acceptor | 27 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 20 |
| (-)-Telosmoside A3 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5984 | 59.84% |
| Caco-2 | - | 0.8657 | 86.57% |
| Blood Brain Barrier | - | 0.5500 | 55.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.6867 | 68.67% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8456 | 84.56% |
| OATP1B3 inhibitior | + | 0.9080 | 90.80% |
| MATE1 inhibitior | - | 1.0000 | 100.00% |
| OCT2 inhibitior | - | 0.6750 | 67.50% |
| BSEP inhibitior | + | 0.9416 | 94.16% |
| P-glycoprotein inhibitior | + | 0.7447 | 74.47% |
| P-glycoprotein substrate | + | 0.7317 | 73.17% |
| CYP3A4 substrate | + | 0.7525 | 75.25% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8898 | 88.98% |
| CYP3A4 inhibition | - | 0.8237 | 82.37% |
| CYP2C9 inhibition | - | 0.9119 | 91.19% |
| CYP2C19 inhibition | - | 0.8908 | 89.08% |
| CYP2D6 inhibition | - | 0.9598 | 95.98% |
| CYP1A2 inhibition | - | 0.9243 | 92.43% |
| CYP2C8 inhibition | + | 0.6854 | 68.54% |
| CYP inhibitory promiscuity | - | 0.9757 | 97.57% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9800 | 98.00% |
| Carcinogenicity (trinary) | Non-required | 0.6831 | 68.31% |
| Eye corrosion | - | 0.9915 | 99.15% |
| Eye irritation | - | 0.8991 | 89.91% |
| Skin irritation | - | 0.6532 | 65.32% |
| Skin corrosion | - | 0.9465 | 94.65% |
| Ames mutagenesis | - | 0.6700 | 67.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7567 | 75.67% |
| Micronuclear | - | 0.8300 | 83.00% |
| Hepatotoxicity | - | 0.6625 | 66.25% |
| skin sensitisation | - | 0.9445 | 94.45% |
| Respiratory toxicity | + | 0.7000 | 70.00% |
| Reproductive toxicity | + | 0.7889 | 78.89% |
| Mitochondrial toxicity | + | 0.6375 | 63.75% |
| Nephrotoxicity | - | 0.9500 | 95.00% |
| Acute Oral Toxicity (c) | I | 0.3669 | 36.69% |
| Estrogen receptor binding | + | 0.8250 | 82.50% |
| Androgen receptor binding | + | 0.7674 | 76.74% |
| Thyroid receptor binding | + | 0.6445 | 64.45% |
| Glucocorticoid receptor binding | + | 0.8018 | 80.18% |
| Aromatase binding | + | 0.7076 | 70.76% |
| PPAR gamma | + | 0.8409 | 84.09% |
| Honey bee toxicity | - | 0.5688 | 56.88% |
| Biodegradation | - | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.5045 | 50.45% |
| Fish aquatic toxicity | + | 0.8107 | 81.07% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.27% | 96.09% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 98.04% | 95.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.48% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.77% | 85.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 95.58% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.97% | 98.10% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 94.83% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.40% | 97.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.01% | 94.45% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.44% | 96.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.39% | 96.47% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.05% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.28% | 100.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.94% | 98.05% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.47% | 89.00% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 89.26% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.04% | 96.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 88.79% | 97.29% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 88.19% | 92.86% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 87.90% | 95.93% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.72% | 92.62% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 87.71% | 92.50% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 86.80% | 97.53% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.78% | 94.33% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 86.51% | 97.36% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.22% | 96.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.68% | 91.19% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.11% | 100.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.04% | 96.21% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.83% | 95.50% |
| CHEMBL204 | P00734 | Thrombin | 84.07% | 96.01% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.94% | 95.71% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.93% | 89.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.63% | 93.56% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.54% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.41% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.36% | 100.00% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.29% | 82.50% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.12% | 91.24% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.55% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.55% | 97.14% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 82.50% | 98.03% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.25% | 95.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.01% | 98.95% |
| CHEMBL5028 | O14672 | ADAM10 | 81.40% | 97.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.03% | 98.75% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 80.41% | 85.31% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.31% | 96.90% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 80.23% | 95.36% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Telosma procumbens |
| PubChem | 162981446 |
| LOTUS | LTS0165255 |
| wikiData | Q105328928 |