Tebernine C
| Internal ID | 138e3721-8f5f-431d-9bad-a10fd815dd3b |
| Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
| IUPAC Name | 2-(3-methyl-9H-pyrido[3,4-b]indol-1-yl)ethanamine |
| SMILES (Canonical) | CC1=CC2=C(C(=N1)CCN)NC3=CC=CC=C32 |
| SMILES (Isomeric) | CC1=CC2=C(C(=N1)CCN)NC3=CC=CC=C32 |
| InChI | InChI=1S/C14H15N3/c1-9-8-11-10-4-2-3-5-12(10)17-14(11)13(16-9)6-7-15/h2-5,8,17H,6-7,15H2,1H3 |
| InChI Key | XQZALXCDRFCRTM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.126597491 g/mol |
| Topological Polar Surface Area (TPSA) | 54.70 Ų |
| XlogP | 2.10 |
| CHEMBL550999 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.31% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.95% | 96.09% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 92.53% | 87.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.36% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.63% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.15% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.86% | 91.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.84% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.53% | 98.95% |
| CHEMBL3227 | P41594 | Metabotropic glutamate receptor 5 | 85.25% | 96.42% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 85.01% | 95.48% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 84.28% | 97.00% |
| CHEMBL1952 | P04818 | Thymidylate synthase | 84.15% | 93.53% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.56% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.50% | 94.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.55% | 98.59% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.02% | 93.31% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.98% | 94.62% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.95% | 93.18% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.61% | 93.65% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 80.51% | 85.49% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.31% | 95.50% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.14% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tabernaemontana elegans |
| PubChem | 44179505 |
| LOTUS | LTS0114400 |
| wikiData | Q105340233 |