Tazettadiol
| Internal ID | e7900ec7-2c6f-43bd-90dc-790f8abb5d9b |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives |
| IUPAC Name | 6-methoxy-3-(6-methoxy-2,4-dioxabicyclo[3.3.1]nona-1(8),5(9),6-trien-7-yl)-1-methyl-3a,6,7,7a-tetrahydro-2H-indol-3-ol |
| SMILES (Canonical) | CN1CC(C2C1CC(C=C2)OC)(C3=C(C4=CC(=C3)OCO4)OC)O |
| SMILES (Isomeric) | CN1CC(C2C1CC(C=C2)OC)(C3=C(C4=CC(=C3)OCO4)OC)O |
| InChI | InChI=1S/C18H23NO5/c1-19-9-18(20,13-5-4-11(21-2)7-15(13)19)14-6-12-8-16(17(14)22-3)24-10-23-12/h4-6,8,11,13,15,20H,7,9-10H2,1-3H3 |
| InChI Key | WGNHCYRPNUGSKT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.15762283 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 1.30 |
| WGNHCYRPNUGSKT-UHFFFAOYSA-N |
| 6-Methoxy-3-[6-methoxy-2,4-dioxabicyclo[3.3.1]nona-1(9),5,7-trien-7-yl]-1-methyl-2,3,3a,6,7,7a-hexahydro-1H-indol-3-ol # |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 98.01% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.87% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.85% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.16% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.85% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.11% | 90.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.95% | 92.62% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.36% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.61% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.10% | 94.00% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 83.32% | 80.96% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.15% | 86.33% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 81.74% | 82.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.55% | 97.09% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.59% | 89.50% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.45% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hippeastrum puniceum |
| PubChem | 550775 |
| LOTUS | LTS0221700 |
| wikiData | Q105304630 |