Taxifolin 7-O-rhamnoside
Internal ID | 8e925703-4dc8-4efd-9867-ef8233ac6a44 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(C(C3=O)O)C4=CC(=C(C=C4)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC(=C3C(=C2)O[C@@H]([C@H](C3=O)O)C4=CC(=C(C=C4)O)O)O)O)O)O |
InChI | InChI=1S/C21H22O11/c1-7-15(25)17(27)19(29)21(30-7)31-9-5-12(24)14-13(6-9)32-20(18(28)16(14)26)8-2-3-10(22)11(23)4-8/h2-7,15,17-25,27-29H,1H3/t7-,15-,17+,18-,19+,20+,21-/m0/s1 |
InChI Key | HNGAZJABJOAMSW-FHXNIQKESA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O11 |
Molecular Weight | 450.40 g/mol |
Exact Mass | 450.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 186.00 Ų |
XlogP | 0.20 |
137592-12-2 |
(2R,3R)-2-(3,4-Dihydroxyphenyl)-3,5-dihydroxy-7-(((2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)chroman-4-one |
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-2,3-dihydrochromen-4-one |
Taxifolin 7-O-a-L-rhamnoside |
HY-N4310 |
s3295 |
AKOS040760732 |
MS-28164 |
CS-0032715 |
F82190 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.41% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.70% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.69% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.79% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.37% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 91.82% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.49% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.22% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.19% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.79% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.37% | 97.09% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.59% | 97.36% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.98% | 90.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.11% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hypericum japonicum |
PubChem | 24721355 |
LOTUS | LTS0217942 |
wikiData | Q105030852 |