Taxicatin
Internal ID | 397acedc-8217-4575-b855-26c06e570110 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
IUPAC Name | (2S,3R,4S,5S,6R)-2-(3,5-dimethoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=CC(=CC(=C1)OC2C(C(C(C(O2)CO)O)O)O)OC |
SMILES (Isomeric) | COC1=CC(=CC(=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC |
InChI | InChI=1S/C14H20O8/c1-19-7-3-8(20-2)5-9(4-7)21-14-13(18)12(17)11(16)10(6-15)22-14/h3-5,10-18H,6H2,1-2H3/t10-,11-,12+,13-,14-/m1/s1 |
InChI Key | JDTIMXKVYWJWHE-RKQHYHRCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H20O8 |
Molecular Weight | 316.30 g/mol |
Exact Mass | 316.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 118.00 Ų |
XlogP | -0.50 |
Taxicatin [MI] |
90-71-1 |
3,5-Dimethoxyphenol glucoside |
UNII-B34E0338PZ |
B34E0338PZ |
beta-D-Glucopyranoside, 3,5-dimethoxyphenyl |
(2S,3R,4S,5S,6R)-2-(3,5-DIMETHOXYPHENOXY)-6-(HYDROXYMETHYL)OXANE-3,4,5-TRIOL |
.BETA.-D-GLUCOPYRANOSIDE, 3,5-DIMETHOXYPHENYL |
Q27274297 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.29% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.05% | 96.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.10% | 94.73% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 86.64% | 95.93% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.42% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.14% | 96.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 83.91% | 97.36% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.85% | 86.92% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.11% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.09% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.57% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.87% | 95.89% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.78% | 95.89% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.74% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
Taxus canadensis |
Taxus cuspidata |
PubChem | 90479391 |
LOTUS | LTS0069656 |
wikiData | Q27274297 |