Taxcultine
Internal ID | d830d1da-6de2-4035-a13f-d4a7e4dff4cd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-[(2R,3S)-3-(butanoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
SMILES (Canonical) | CCCC(=O)NC(C1=CC=CC=C1)C(C(=O)OC2CC3(C(C4C(C(CC5C4(CO5)OC(=O)C)O)(C(=O)C(C(=C2C)C3(C)C)OC(=O)C)C)OC(=O)C6=CC=CC=C6)O)O |
SMILES (Isomeric) | CCCC(=O)N[C@@H](C1=CC=CC=C1)[C@H](C(=O)O[C@H]2C[C@]3([C@H]([C@H]4[C@@]([C@H](C[C@@H]5[C@]4(CO5)OC(=O)C)O)(C(=O)[C@@H](C(=C2C)C3(C)C)OC(=O)C)C)OC(=O)C6=CC=CC=C6)O)O |
InChI | InChI=1S/C44H53NO14/c1-8-15-31(49)45-33(26-16-11-9-12-17-26)34(50)40(53)57-28-21-44(54)38(58-39(52)27-18-13-10-14-19-27)36-42(7,29(48)20-30-43(36,22-55-30)59-25(4)47)37(51)35(56-24(3)46)32(23(28)2)41(44,5)6/h9-14,16-19,28-30,33-36,38,48,50,54H,8,15,20-22H2,1-7H3,(H,45,49)/t28-,29-,30+,33-,34+,35+,36-,38-,42+,43-,44+/m0/s1 |
InChI Key | SXPIMOCRRJUHJY-MNLIZOKASA-N |
Popularity | 3 references in papers |
Molecular Formula | C44H53NO14 |
Molecular Weight | 819.90 g/mol |
Exact Mass | 819.34660536 g/mol |
Topological Polar Surface Area (TPSA) | 221.00 Ų |
XlogP | 1.70 |
153415-46-4 |
Taxol D |
[(1S,2S,3R,4S,7R,9S,10S,12R,15S)-4,12-diacetyloxy-15-[(2R,3S)-3-(butanoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-1,9-dihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
Benzenepropanoic acid, alpha-hydroxy-beta-((1-oxobutyl)amino)-, 6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca(3,4)benz(1,2-b)oxet-9-yl ester, (2aR-(2aalpha,4beta,4abeta,6beta,9alpha(al |
TAXCULTIN |
CHEMBL77236 |
DTXSID80165323 |
C44H53NO14 |
AKOS040762401 |
C44-H53-N-O14 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 99.96% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 99.57% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.08% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.72% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.87% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.50% | 86.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.41% | 99.23% |
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 92.89% | 87.67% |
CHEMBL2535 | P11166 | Glucose transporter | 92.71% | 98.75% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.64% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.10% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.57% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.56% | 94.45% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.28% | 95.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.26% | 95.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 90.20% | 97.79% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.58% | 91.49% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.48% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.39% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.53% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 88.40% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.83% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.63% | 82.69% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 86.59% | 92.98% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.24% | 92.67% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 85.67% | 83.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.91% | 92.62% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.65% | 81.11% |
CHEMBL4267 | P37173 | TGF-beta receptor type II | 82.64% | 88.18% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.24% | 97.14% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.03% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus baccata |
Taxus canadensis |
Taxus cuspidata |
PubChem | 3081898 |
NPASS | NPC206211 |
ChEMBL | CHEMBL77236 |
LOTUS | LTS0031851 |
wikiData | Q83034470 |