Taurodeoxycholic Acid
| Internal ID | 1a6ef623-79ad-43b7-9d4a-c3fe6d57fadd |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Bile acids, alcohols and derivatives > Taurinated bile acids and derivatives |
| IUPAC Name | 2-[[(4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES (Canonical) | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |
| SMILES (Isomeric) | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C |
| InChI | InChI=1S/C26H45NO6S/c1-16(4-9-24(30)27-12-13-34(31,32)33)20-7-8-21-19-6-5-17-14-18(28)10-11-25(17,2)22(19)15-23(29)26(20,21)3/h16-23,28-29H,4-15H2,1-3H3,(H,27,30)(H,31,32,33)/t16-,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1 |
| InChI Key | AWDRATDZQPNJFN-VAYUFCLWSA-N |
| Popularity | 621 references in papers |
| Molecular Formula | C26H45NO6S |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.29675933 g/mol |
| Topological Polar Surface Area (TPSA) | 132.00 Ų |
| XlogP | 3.60 |
| Atomic LogP (AlogP) | 3.40 |
| H-Bond Acceptor | 5 |
| H-Bond Donor | 4 |
| Rotatable Bonds | 7 |
| Taurodeoxycholate |
| Deoxycholyltaurine |
| Tudcabil |
| Taurodesoxycholic acid |
| TAURODEOXYCHLOIC ACID |
| 516-50-7 |
| CHEBI:9410 |
| CHEMBL412272 |
| HY209 |
| HY-209 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7944 | 79.44% |
| Caco-2 | - | 0.9080 | 90.80% |
| Blood Brain Barrier | + | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.5714 | 57.14% |
| Subcellular localzation | Mitochondria | 0.4120 | 41.20% |
| OATP2B1 inhibitior | + | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8440 | 84.40% |
| OATP1B3 inhibitior | + | 0.9307 | 93.07% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8064 | 80.64% |
| BSEP inhibitior | + | 0.7775 | 77.75% |
| P-glycoprotein inhibitior | - | 0.4417 | 44.17% |
| P-glycoprotein substrate | + | 0.7769 | 77.69% |
| CYP3A4 substrate | + | 0.7439 | 74.39% |
| CYP2C9 substrate | - | 0.8058 | 80.58% |
| CYP2D6 substrate | - | 0.8239 | 82.39% |
| CYP3A4 inhibition | - | 0.8612 | 86.12% |
| CYP2C9 inhibition | - | 0.8625 | 86.25% |
| CYP2C19 inhibition | - | 0.8426 | 84.26% |
| CYP2D6 inhibition | - | 0.8685 | 86.85% |
| CYP1A2 inhibition | - | 0.7814 | 78.14% |
| CYP2C8 inhibition | - | 0.6144 | 61.44% |
| CYP inhibitory promiscuity | - | 0.7175 | 71.75% |
| UGT catelyzed | + | 0.7362 | 73.62% |
| Carcinogenicity (binary) | + | 0.6300 | 63.00% |
| Carcinogenicity (trinary) | Non-required | 0.6284 | 62.84% |
| Eye corrosion | - | 0.9710 | 97.10% |
| Eye irritation | - | 0.9220 | 92.20% |
| Skin irritation | - | 0.7668 | 76.68% |
| Skin corrosion | - | 0.8836 | 88.36% |
| Ames mutagenesis | - | 0.7081 | 70.81% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5295 | 52.95% |
| Micronuclear | + | 0.7200 | 72.00% |
| Hepatotoxicity | + | 0.6816 | 68.16% |
| skin sensitisation | - | 0.8455 | 84.55% |
| Respiratory toxicity | + | 0.8222 | 82.22% |
| Reproductive toxicity | + | 0.8556 | 85.56% |
| Mitochondrial toxicity | + | 0.6500 | 65.00% |
| Nephrotoxicity | - | 0.8433 | 84.33% |
| Acute Oral Toxicity (c) | III | 0.7688 | 76.88% |
| Estrogen receptor binding | + | 0.5332 | 53.32% |
| Androgen receptor binding | + | 0.7816 | 78.16% |
| Thyroid receptor binding | + | 0.6452 | 64.52% |
| Glucocorticoid receptor binding | + | 0.7727 | 77.27% |
| Aromatase binding | + | 0.6121 | 61.21% |
| PPAR gamma | + | 0.6129 | 61.29% |
| Honey bee toxicity | - | 0.6652 | 66.52% |
| Biodegradation | - | 0.6750 | 67.50% |
| Crustacea aquatic toxicity | - | 0.5400 | 54.00% |
| Fish aquatic toxicity | + | 0.9449 | 94.49% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 |
680 nM |
EC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.25% | 94.45% |
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 99.12% | 85.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.21% | 96.09% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.34% | 96.38% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.15% | 98.05% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.12% | 98.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.19% | 95.93% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.99% | 90.71% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.91% | 97.25% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 90.59% | 95.34% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 89.83% | 82.69% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.49% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.45% | 91.19% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.39% | 96.77% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 89.02% | 98.10% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.49% | 100.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.46% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.44% | 99.23% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 87.37% | 93.10% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.35% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.10% | 97.09% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 86.89% | 97.50% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.77% | 98.75% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.46% | 98.59% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 86.15% | 81.88% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 85.79% | 96.25% |
| CHEMBL5600 | P27448 | Serine/threonine-protein kinase c-TAK1 | 85.57% | 88.81% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 85.48% | 95.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 85.21% | 98.77% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.12% | 94.66% |
| CHEMBL238 | Q01959 | Dopamine transporter | 84.63% | 95.88% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.40% | 91.38% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.39% | 95.50% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.05% | 94.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.94% | 96.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.45% | 91.24% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 83.24% | 92.98% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.24% | 96.90% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.98% | 90.17% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.53% | 95.83% |
| CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 82.12% | 95.36% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.10% | 93.04% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.42% | 100.00% |
| CHEMBL3921 | Q9Y251 | Heparanase | 81.19% | 94.00% |
| CHEMBL5028 | O14672 | ADAM10 | 80.99% | 97.50% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.96% | 98.33% |
| CHEMBL5646 | Q6L5J4 | FML2_HUMAN | 80.71% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 80.62% | 96.03% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.60% | 96.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.12% | 94.45% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.01% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 2733768 |
| LOTUS | LTS0152375 |
| wikiData | Q7688896 |