Tartronic acid
| Internal ID | a5e3157b-cf80-4e0f-9bc4-a6726dd67ba7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Dicarboxylic acids and derivatives |
| IUPAC Name | 2-hydroxypropanedioic acid |
| SMILES (Canonical) | C(C(=O)O)(C(=O)O)O |
| SMILES (Isomeric) | C(C(=O)O)(C(=O)O)O |
| InChI | InChI=1S/C3H4O5/c4-1(2(5)6)3(7)8/h1,4H,(H,5,6)(H,7,8) |
| InChI Key | ROBFUDYVXSDBQM-UHFFFAOYSA-N |
| Popularity | 297 references in papers |
| Molecular Formula | C3H4O5 |
| Molecular Weight | 120.06 g/mol |
| Exact Mass | 120.00587322 g/mol |
| Topological Polar Surface Area (TPSA) | 94.80 Ų |
| XlogP | -1.10 |
| 80-69-3 |
| 2-Hydroxymalonic acid |
| Hydroxymalonic acid |
| 2-Hydroxypropanedioic acid |
| Tartronicacid |
| Propanedioic acid, hydroxy- |
| hydroxypropanedioic acid |
| 2-Tartronic acid |
| 2-hydroxymalonate |
| MALONIC ACID, HYDROXY- |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.14% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.98% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pogostemon cablin |
| PubChem | 45 |
| LOTUS | LTS0155922 |
| wikiData | Q425473 |